تفاعل #5999

ord-bd3436a3a9104be29be12b6fb5ed6ff9

معادلة التفاعل

O=C(Cl)OCc1ccccc1
benzyloxycarbonyl chloride
Cl
hydrochloric acid
[Na+].[Na+].[Na+].[O-]B([O-])[O-]
sodium borate
Cl.NCCc1ccc(O)c(O)c1
dopamine hydrochloride
[Na+].[OH-]
sodium hydroxide
[Na+].[OH-]
sodium hydroxide
O=C(NCCc1ccc(O)c(O)c1)OCc1ccccc1
desired compound
المردود 96.5%
O=C(NCCc1ccc(O)c(O)c1)OCc1ccccc1
N-carbobenzoxydopamine
المردود 96.5%

المذيبات

ظروف التفاعل

درجة الحرارة
15°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىTo the solution thus obtained
  2. 2
    درجة الحرارةto maintain the pH value of the reaction mixture to 9
  3. 3
    أخرىstirring for 2 hours
  4. 4
    استخلاصextracted with diethyl ether
  5. 5
    تجفيفNext, it was dried over anhydrous magnesium sulfate
  6. 6
    workup.DISTILLATIONthe solvent was distilled off
  7. 7
    غسيلAfter washing the residue with petroleum ether
  8. 8
    أخرىthe crude crystals thus obtained
  9. 9
    أخرىwere recrystallized from ethanol/n-hexane (1 : 1 by volume)

الإجراء التجريبي

38.2 g (100 mmol) of sodium borate and 18.9 g (100 mmol) of dopamine hydrochloride were dissolved in 250 ml of water. To the solution thus obtained, was added a 2 N sodium hydroxide solution under a nitrogen gas stream to adjust the pH value to 9. Then 17.1 g (100 mmol) of benzyloxycarbonyl chloride was added dropwise thereto while stirring at 15° C. for 4 hours. Simultaneously, a 2 N sodium hydroxide solution was added to maintain the pH value of the reaction mixture to 9. After continuing the stirring for 2 hours, the mixture was adjusted to pH 1 to 2 with hydrochloric acid and then extracted with diethyl ether. Next, it was dried over anhydrous magnesium sulfate and the solvent was distilled off. After washing the residue with petroleum ether, the crude crystals thus obtained were recrystallized from ethanol/n-hexane (1 : 1 by volume). Thus 27.6 g (yield: 96.5% of the desired compound (m.p.: 134°- 135 ° C.) was obtained in the form of white crystals.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05246949uspto-grants-1993_09