تفاعل #586136

ord-56146754b79b458583b98711961271b0

معادلة التفاعل

O=C([O-])O.[Na+]
sodium bicarbonate
CC(C)Sc1cccc(-c2ccc(Cl)cc2Cl)c1
[3-(2,4-dichlorophenyl)phenyl] isopropyl sulfide
O=C(OO)c1cccc(Cl)c1
m-chloroperbenzoic acid
CC(C)S(=O)c1cccc(-c2ccc(Cl)cc2Cl)c1
[3-(2,4-dichlorophenyl)phenyl] isopropyl sulfoxide
المردود 85.0%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.STIRRINGthe reaction mixture was stirred for 2 hours
  2. 2
    workup.STIRRINGThe reaction mixture was stirred at room temperature for another 12 hours
  3. 3
    غسيلThe chloroform layer was washed with 5% aqueous sodium sulfite and water
  4. 4
    تجفيفdried over anhydrous magnesium sulfate
  5. 5
    workup.DISTILLATIONthe solvent was distilled off under reduced pressure
  6. 6
    أخرىPurification of the residue by silica gel column chromatography

الإجراء التجريبي

To 1.0 g (3.4 mmol) of [3-(2,4-dichlorophenyl)phenyl] isopropyl sulfide in 50 ml of chloroform, 0.7 g (4.1 mmol) of m-chloroperbenzoic acid was added at 0° C. with stirring, and the reaction mixture was stirred for 2 hours. The reaction mixture was stirred at room temperature for another 12 hours, and 5% aqueous sodium bicarbonate was added for separation. The chloroform layer was washed with 5% aqueous sodium sulfite and water and dried over anhydrous magnesium sulfate, and the solvent was distilled off under reduced pressure. Purification of the residue by silica gel column chromatography afforded 0.9 g of [3-(2,4-dichlorophenyl)phenyl] isopropyl sulfoxide (yield 85.0%) as a colorless dough (nD20 1.6169).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07767626B2uspto-grants-2010_08