تفاعل #531843

ord-e8993a482e264607916821b1a435b3a0

معادلة التفاعل

[Al+3].[H-].[H-].[H-].[H-].[Li+]
lithium aluminum hydride
[Al+3].[H-].[H-].[H-].[H-].[Li+]
lithium aluminum hydride
O=S1(=O)c2cc(Br)ccc2-c2ccc(Br)cc21
3,7-dibromodibenzothiophene dioxide
CCOCC
ether
Cl
hydrochloric acid
Brc1ccc2c(c1)sc1cc(Br)ccc12
3,7-dibromodibenzothiophene
المردود 48.1%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةthe resulting mixture is refluxed
  2. 2
    workup.STIRRINGthe mixture is thoroughly stirred
  3. 3
    أخرىthe organic layer is separated
  4. 4
    استخلاصThe aqueous layer is further extracted with chloroform (200 ml×2)
  5. 5
    استخلاصthe chloroform extract
  6. 6
    غسيلthe combined organic layer is washed with water (200 ml) and saturated brine (200 ml)
  7. 7
    تجفيفdried over calcium chloride
  8. 8
    workup.DISTILLATIONThe solvent is distilled off
  9. 9
    أخرىcolorless crystals thus obtained
  10. 10
    أخرىare recrystallized from ethyl acetate+ethanol (16:3)

الإجراء التجريبي

In a 500-ml flask, lithium aluminum hydride (4.1 g) is slowly introduced in small amounts over 50 minutes into a mixture of 3,7-dibromodibenzothiophene dioxide (20 g) and anhydrous ether (200 ml) in an ice bath, and the resulting mixture is refluxed and stirred for 2 hours. Water (200 ml) is added thereto to deactivate lithium aluminum hydride. Chloroform (200 ml) and concentrated hydrochloric acid (40 ml) are added thereto, the mixture is thoroughly stirred, and the organic layer is separated. The aqueous layer is further extracted with chloroform (200 ml×2), the chloroform extract is combined with the organic layer, and the combined organic layer is washed with water (200 ml) and saturated brine (200 ml), and dried over calcium chloride. The solvent is distilled off, and colorless crystals thus obtained are recrystallized from ethyl acetate+ethanol (16:3). Thus, 8.8 g of 3,7-dibromodibenzothiophene is obtained.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08475984B1uspto-grants-2013_07