تفاعل #487555

ord-61be4968a74b463195197dfc717efde7

معادلة التفاعل

CCc1ccc(-c2ccc(Cl)cc2)cc1[N+](=O)[O-]
4′-Chloro-4-ethyl-3-nitrobiphenyl
O
water
[Cl-].[NH4+]
ammonium chloride
CCc1ccc(-c2ccc(Cl)cc2)cc1N
3-amino-4′-chloro-4-ethylbiphenyl
المردود 75.3%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةthe mixture is heated
  2. 2
    درجة الحرارةto reflux for 1 hour
  3. 3
    درجة الحرارةThe reaction mixture is cooled to room temperature
  4. 4
    ترشيحfiltered through diatomaceous earth
  5. 5
    أخرىthe filtrate is evaporated in vacuo
  6. 6
    أخرىto remove most of the methanol
  7. 7
    أخرىThe residue is partitioned between ethyl acetate (200 ml) and water
  8. 8
    استخلاصthe aqueous phase is re-extracted with ethyl acetate (200 ml)
  9. 9
    غسيلwashed with water and brine
  10. 10
    تجفيفdried over anhydrous magnesium sulfate
  11. 11
    ترشيحfiltered
  12. 12
    أخرىthe filtrate is evaporated in vacuo

الإجراء التجريبي

4′-Chloro-4-ethyl-3-nitrobiphenyl (22.6 g, 0.086 mol) is suspended in methanol (250 ml) and the reaction mixture is stirred at room temperature. Distilled water (100 ml) is added, followed by zinc dust (39.0 g, 0.60 mol) and ammonium chloride (13.8 g, 0.26 mol) and the mixture is heated to reflux for 1 hour. The reaction mixture is cooled to room temperature, filtered through diatomaceous earth and the filtrate is evaporated in vacuo to remove most of the methanol. The residue is partitioned between ethyl acetate (200 ml) and water and the aqueous phase is re-extracted with ethyl acetate (200 ml). The organic extracts are combined, washed with water and brine, dried over anhydrous magnesium sulfate, filtered and the filtrate is evaporated in vacuo to give 3-amino-4′-chloro-4-ethylbiphenyl (15.0 g) as a colourless solid. The product is used directly without further purification in Step 5.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08741806B2uspto-grants-2014_06