تفاعل #481613

ord-188ba38aee054365849e8b30ebbfb5f1

معادلة التفاعل

CCCCCCCCCCCCCCCCCC(=O)OC
methyl stearate
CCCCCCCC/C=C\CCCCCCCC(=O)OC
methyl oleate
CCCCC/C=C\C/C=C\C/C=C\CCCCCCC(=O)O
DGLA

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىMethyl ester of DGLA is recovered preferably
  2. 2
    استخلاصby extracting the above-mentioned treated solution with an organic solvent such as hexane
  3. 3
    استخلاصNext, the resulting extract
  4. 4
    تجفيفis dried on, for example, anhydrous sodium sulfate
  5. 5
    workup.DISTILLATIONthe solvent is distilled off preferably under reduced pressure
  6. 6
    أخرىto obtain a mixture

الإجراء التجريبي

Methyl ester of DGLA is recovered preferably by extracting the above-mentioned treated solution with an organic solvent such as hexane, an ether such as ethyl ether, or an ester such as ethyl acetate. Next, the resulting extract is dried on, for example, anhydrous sodium sulfate, and the solvent is distilled off preferably under reduced pressure to obtain a mixture comprising fatty acid esters. This mixture contains, in addition to the desired fatty acid HGLA methyl ester, other fatty acid methyl esters, such as methyl parmitate, methyl stearate, methyl oleate and the like. To isolate methyl ester of DGLA from the mixture of these fatty acid methyl esters, column chromatography, low temperature crystallization, the urea-inclusion method, the liquid/liquid countercurrent chromatography method, and the like can be used alone or in combination.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US06602690B2uspto-grants-2003_08