تفاعل #465936

ord-569aa3c54bb04ab58ccf738ad83df48a

معادلة التفاعل

COC(=O)c1cc(OC(C)=O)c2cc(OC)c(OC)cc2c1-c1ccccc1
1-Phenyl-2-methoxycarbonyl-4-acetoxy-6,7-dimethoxynaphthalene
[Na+].[OH-]
sodium hydroxide
COc1cc2c(O)cc(C(=O)O)c(-c3ccccc3)c2cc1OC
1-phenyl-4-hydroxy-6,7-dimethoxy-2-naphthoic acid
المردود 100.7%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةheated
  2. 2
    درجة الحرارةto reflux for 3 hours
  3. 3
    أخرىA white precipitate formed
  4. 4
    ترشيحwas collected by vacuum filtration
  5. 5
    غسيلwashed with water
  6. 6
    أخرىwas air-dried
  7. 7
    أخرىRecrystallization from ethanol (95 weight percent)

الإجراء التجريبي

1-Phenyl-2-methoxycarbonyl-4-acetoxy-6,7-dimethoxynaphthalene (66.4 grams) from Step 3, 500 mL of a 10 weight percent aqueous sodium hydroxide solution and 50 mL of methanol were added to a reaction flask and heated to reflux for 3 hours and then cooled to room temperature. The reaction mixture was poured onto an aqueous solution of 4N hydrochloric acid/ice mixture (˜400 mL). A white precipitate formed and was collected by vacuum filtration, washed with water and was air-dried. Recrystallization from ethanol (95 weight percent) gave 57 grams of 1-phenyl-4-hydroxy-6,7-dimethoxy-2-naphthoic acid.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US06296785B1uspto-grants-2001_10