تفاعل #460865

ord-5a4a4f37dc3841d48e6f6e11d07190f9

معادلة التفاعل

CC(O)c1c(SCc2ccccc2)ncn1C
5-(1-Hydroxyethyl)-1-methyl-4-(phenylmethyl)thioimidazole
CC(=O)c1c(SCc2ccccc2)ncn1C
5-acetyl-1-methyl-4-(phenylmethyl)thioimidazole
المردود 21.1%

الكواشف

لا شيء

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةrefluxed for 4 hours
  2. 2
    درجة الحرارةThe reaction mixture was cooled
  3. 3
    ترشيحfiltered
  4. 4
    غسيلwashed with dichloromethane
  5. 5
    أخرىevaporated under reduced pressure
  6. 6
    أخرىto provide crude product
  7. 7
    أخرىPurification by flash chromatography

الإجراء التجريبي

5-(1-Hydroxyethyl)-1-methyl-4-(phenylmethyl)thioimidazole (6.2 g. 25 mmol) in acetone (310 ml) and active manganese IV oxide (62 g), under a calcium chloride drying tube, were mechanically stirred and refluxed for 4 hours. The reaction mixture was cooled, filtered, washed with dichloromethane and evaporated under reduced pressure to provide crude product. Purification by flash chromatography starting with dichloromethane followed by 1%, 2% and 10% methanol in dichloromethane provided 1.3 g of 5-acetyl-1-methyl-4-(phenylmethyl)thioimidazole (21%) and 3.6 g of starting material 5-(1-hydroxyethyl)-1-methyl-4-(phenylmethyl)thioimidazole (58%). The yield based on the starting material consumed is 50%; mp 62° C.; -H NMR(300 MHz, CDCl3) δ 2.49 (s, 3H, CH3CO), 3.86 (s, 3H, NCH3), 4.45 (3, 2H, SCH2), 7.26-7.37 (m, 5H, ArH), 7.49(s, 1H, 1m H-2); 13C NMR(75 MHz, CDCl3) δ 30.4, 35.6, 37.2, 127.2, 128.1, 128.5, 129.0, 137.8, 142.0, 145.4, 188.4 (C=O) ppm; IR (CCl14) 3060, 2960, 1665 (C=O), 1550, 1515, 1250, 825, 730 cm-1, LRMS (ei) m/z 246 (M+ -SH, 100), 155 (23), 91 (C7H7+ 95), 81 (29), 42 (23); HRMS (ei) calc. 246.0827 obsd. 246.0826.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05164511uspto-grants-1992_11