تفاعل #410698

ord-2f326ebe39f649b18b5cf54b76607de8

معادلة التفاعل

O=S(=O)([O-])OOS(=O)(=O)[O-].[Na+].[Na+]
sodium persulfate
O=S(=O)([O-])OOS(=O)(=O)[O-].[NH4+].[NH4+]
ammonium persulfate
[Na+].[OH-]
sodium hydroxide
[K+].[OH-]
potassium hydroxide
O=S(=O)([O-])OOS(=O)(=O)[O-].[K+].[K+]
potassium persulfate

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.DISSOLUTIONis re-dissolved in the next step
  2. 2
    أخرىIn the aforesaid reaction step

الإجراء التجريبي

The ammonium persulfate in the form of crystal thus obtained is re-dissolved in the next step, and is transferred to the step of reaction with sodium hydroxide or potassium hydroxide. In the aforesaid reaction step, a solution containing sodium persulfate or potassium persulfate is produced, then is concentrated and separated by vacuum crystallization, centrifugal filtration or the like and is subsequently taken out as a crystal. As stated hereinbefore, the process for producing sodium persulfate or potassium persulfate by the reaction of ammonium persulfate and sodium hydroxide or potassium hydroxide necessitates quite a long production steps and a number of steps and moreover, lowers the yield of the objective sodium persulfate or potassium persulfate based on the ammonium persulfate, thereby making itself far from economically advantageous.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US06214197B1uspto-grants-2001_04