تفاعل #364635

ord-c7a1b840f5364511b62f39234356208e

معادلة التفاعل

O=C([O-])[O-].[Na+].[Na+]
sodium carbonate
O=C(O)c1ccc(C(F)(F)F)cc1
4-trifluoromethylbenzoic acid
CC(C)(C)CO
2,2-dimethyl-propyl alcohol
O=S(=O)(O)O
sulfuric acid
CC(C)(C)COC(=O)c1ccc(C(F)(F)F)cc1
4-trifluoromethyl-benzoic acid, 2,2-dimethyl-propyl ester
المردود 99.5%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةat reflux for 4 hours
  2. 2
    أخرىthe layers were separated
  3. 3
    غسيلThe organic layer was washed with saturated aqueous sodium carbonate (250 mL), and brine (100 mL)
  4. 4
    تركيزwas concentrated

الإجراء التجريبي

To a suspension of 4-trifluoromethylbenzoic acid (75.0 g, 394 mmol) and 2,2-dimethyl-propyl alcohol (70.5 g, 800 mmol) in toluene (500 mL) was added concentrated sulfuric acid (3.0 mL). The mixture was stirred at reflux for 4 hours, cooled to room temperature, poured into saturated aqueous sodium carbonate (250 mL) and the layers were separated. The organic layer was washed with saturated aqueous sodium carbonate (250 mL), and brine (100 mL), and was concentrated to give 4-trifluoromethyl-benzoic acid, 2,2-dimethyl-propyl ester (102 g, 99% yield) as a yellow liquid: Rf: 0.66 (ethyl acetate/hexanes 25/75); IR 2932, 1727, 1327, 1280, 1133, 1066, 862, 775, 704 cm−1; 1H NMR (400 MHz, CDCl3) δ8.16 (d, J=7.9 Hz, 2H), 7.70 (d, J=8.1 Hz, 2H), 4.04 (s, 2H), 1.04 (s, 9); 13C NMR (100 MHz, CDCl3) δ26.51, 31.61, 74.72, 123.63 (q, J=272.7 HZ), 125.4, 129.9, 133.7, 134.35 (q, J=31.7 Hz), 165.35.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US06355825B1uspto-grants-2002_03