تفاعل #360857

ord-e9194eb99acd413f91c949a0e7eb6266

معادلة التفاعل

OB(O)c1ccc(CCBr)cc1
4-(2-Bromoethyl)phenyl boronic acid
O=[N+]([O-])c1ncc[nH]1
2-nitroimidazole
O=C([O-])[O-].[K+].[K+]
potassium carbonate
O=[N+]([O-])c1nc(CCc2ccc(B(O)O)cc2)c[nH]1
bromide
المردود 14.1%
O=[N+]([O-])c1nc(CCc2ccc(B(O)O)cc2)c[nH]1
4-(2 -Nitroimidazolyl ethyl)phenyl boronic acid
المردود 14.1%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىDimethylformamide was removed under reduced pressure
  2. 2
    workup.DISSOLUTIONthe resulting gum was dissolved in a minimum amount of water
  3. 3
    ترشيحThe precipitated solid was filtered off
  4. 4
    غسيلwashed with water
  5. 5
    استخلاصThe combined aqueous portion was again extracted with ethyl acetate (5×50 ml)
  6. 6
    أخرىThe organic layer was dried
  7. 7
    تركيزconcentrated
  8. 8
    أخرىchromatographed (silica gel)
  9. 9
    غسيلElution with 1:1 ethyl acetate/hexane

الإجراء التجريبي

4-(2-Bromoethyl)phenyl boronic acid (0.525 g, 2.72 mmol) and 2-nitroimidazole (0.3 g, 2.72 mmol) were heated in dry dimethylformamide (15 ml) in presence of anhydrous potassium carbonate (1.38 g, 10 mmol) under nitrogen with stirring at 60°-70° C. for 48 hours. Dimethylformamide was removed under reduced pressure and the resulting gum was dissolved in a minimum amount of water and acidified with 2N hydrochloric acid. The precipitated solid was filtered off and washed with water. The combined aqueous portion was again extracted with ethyl acetate (5×50 ml). The organic layer was dried, concentrated and combined with the previously precipitated solid and chromatographed (silica gel). Elution with 1:1 ethyl acetate/hexane yielded some unreacted starting bromide (0.1 g); continued elution with 2:1 ethyl acetate/hexane provided the required boronic acid as a pale yellow crystalline solid. The product was recrystallized from tetrahydrofuran/hexane. Yield: 0.25 g (36%), m.p. 229°-231° C., M.S. (M+H)+ 262.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05387409uspto-grants-1995_02