تفاعل #347990

ord-e22d6a256a3a4510a0e8e1f40b074299

معادلة التفاعل

COc1cccc(C(=O)Cl)c1C
3-methoxy-2-methylbenzoyl chloride
[Na+].[OH-]
sodium hydroxide
[Na+].[OH-]
sodium hydroxide
CC(C)(C)NN.Cl
tert-butylhydrazine hydrochloride
COc1cccc(C(=O)NNC(C)(C)C)c1C
N-(3-methoxy-2-methylbenzoyl)-N'-tert-butylhydrazine
المردود 96.0%

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.ADDITIONwere added concurrently at -20° C
  2. 2
    workup.ADDITIONAfter the addition
  3. 3
    غسيلthe organic layer was washed with water (4×500 mL)
  4. 4
    تجفيفdried over magnesium sulfate

الإجراء التجريبي

To a stirred suspension of tert-butylhydrazine hydrochloride (397 g, 3.27 mole) in methylene chloride (2 L) at 0° C., was added sodium hydroxide (50% aqueous, 260 g) diluted with water (400 mL). Following this, 3-methoxy-2-methylbenzoyl chloride (140 g, 0.78 mole) in methylene chloride (1 L) and sodium hydroxide (50% aqueous, 80 g) dilutect with water (400 mL) were added concurrently at -20° C. After the addition was complete, the reaction mixture was allowed to warm to room temperature and after additional 30 minutes, the organic layer was washed with water (4×500 mL), dried over magnesium sulfate and stripped to yield N-(3-methoxy-2-methylbenzoyl)-N'-tert-butylhydrazine (177 g). 1H-NMR (CDCl3) δppm 1.19 (s, 9H, t-Bu), 2.29 (s, 3H, CH3), 3.87 (s, 3H, OCH3), 6.90 (d, 1H, C-4 or 6 ), 6.95 (d, 1H, C-4 or C6) 7.19 (dd, 1H, C-5).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05530028uspto-grants-1996_06