تفاعل #335360

ord-a87f303f0be841629e4d49b56aa519a5

معادلة التفاعل

ClCc1ccccc1
Benzyl chloride
CC(C(=O)O)c1ccc2cc(O)ccc2c1
6-hydroxy-α-methyl-2-naphthaleneacetic acid
C[O-].[Na+]
sodium methoxide
CC(C(=O)O)c1ccc2cc(OCc3ccccc3)ccc2c1
white crystals
المردود 38.1%
CC(C(=O)O)c1ccc2cc(OCc3ccccc3)ccc2c1
α-Methyl-6-(phenylmethoxy)-2-naphthaleneacetic acid
المردود 38.1%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىAfter 10 minutes the solvent is removed
  2. 2
    درجة الحرارةThe reaction is then heated at 150° C. for 1 hour
  3. 3
    أخرىThe solvent is then removed
  4. 4
    أخرىthe residue is partitioned between water and methylene chloride
  5. 5
    غسيلThe organic layer is washed with water
  6. 6
    تجفيفdried over magnesium sulfate
  7. 7
    أخرىevaporated to 11.5 g of crude product
  8. 8
    استخلاصThis crude product is extracted with 100 ml hot hexane which

الإجراء التجريبي

To a solution of 6-hydroxy-α-methyl-2-naphthaleneacetic acid (6.48 g, 30 mmol) in methanol (100 ml) is added sodium methoxide (60 mmol). After 10 minutes the solvent is removed and replaced with dimethylformamide (100 ml). Benzyl chloride (7.6 g, 60 mmol) is then added and the reaction mixture is stirred overnight at room temperature. The reaction is then heated at 150° C. for 1 hour. The solvent is then removed and the residue is partitioned between water and methylene chloride. The organic layer is washed with water, dried over magnesium sulfate and evaporated to 11.5 g of crude product. This crude product is extracted with 100 ml hot hexane which affords 3.5 g of white crystals. A final recrystallization from methanol affords 2.5 g of white crystals of the intermediate ether ester (21% yield, m.p. 76°-78° C.).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05208344uspto-grants-1993_05