تفاعل #318111

ord-98c61b32b2014508951e69474095d4ab

معادلة التفاعل

CC(C)(C)OC(=O)NC(C)(C)C(=O)[O-]
2-(tert-butoxycarbonylamino)-2-methylpropionate
O=C(OCc1ccccc1)N1CCNCC1
1-(benzyloxycarbonyl)piperazine
On1nnc2ccccc21
1-hydroxybenzotriazole
CCN=C=NCCCN(C)C.Cl
1-ethyl-3-(3-dimethylaminopropyl)carbodiimide hydrochloride
Cl
hydrochloric acid
CC(C)(N)C(=O)N1CCN(C(=O)OCc2ccccc2)CC1.Cl
title compound
المردود 67.8%
CC(C)(N)C(=O)N1CCN(C(=O)OCc2ccccc2)CC1.Cl
1-(2-Amino-2-methylpropionyl)-4-(benzyloxycarbonyl)piperazine hydrochloride
المردود 67.8%

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    استخلاصthe resulting mixture was extracted with ethyl acetate
  2. 2
    غسيلThe extract was washed with water, 1 mol/L aqueous sodium hydroxide solution, water and brine successively
  3. 3
    تجفيفdried over anhydrous sodium sulfate
  4. 4
    أخرىThe solvent was removed under reduced pressure
  5. 5
    workup.ADDITIONTo the residue was added 4 mol/L hydrochloric acid (1,4-dioxane solution, 25 mL)
  6. 6
    workup.STIRRINGthe mixture was stirred at room temperature for 4 hours
  7. 7
    workup.ADDITIONTo the reaction mixture was added diethyl ether (50 mL)
  8. 8
    ترشيحthe insoluble material was collected by filtration
  9. 9
    غسيلThe collected solid was washed with diethyl ether
  10. 10
    أخرىdried under reduced pressure

الإجراء التجريبي

To a solution of 2-(tert-butoxycarbonylamino)-2-methylpropionate (4.06 g) in N,N-dimethylformamide (40 mL) were added 1-(benzyloxycarbonyl)piperazine (6.6 g), 1-hydroxybenzotriazole (3.24 g), 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide hydrochloride (7.67 g) and triethylamine (11.2 mL), and the mixture was stirred at room temperature overnight. The reaction mixture was poured into 1 mol/L hydrochloric acid, and the resulting mixture was extracted with ethyl acetate. The extract was washed with water, 1 mol/L aqueous sodium hydroxide solution, water and brine successively, and dried over anhydrous sodium sulfate. The solvent was removed under reduced pressure. To the residue was added 4 mol/L hydrochloric acid (1,4-dioxane solution, 25 mL), and the mixture was stirred at room temperature for 4 hours. To the reaction mixture was added diethyl ether (50 mL), and the insoluble material was collected by filtration. The collected solid was washed with diethyl ether and dried under reduced pressure to give the title compound (4.65 g).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07566699B2uspto-grants-2009_07