تفاعل #315786

ord-13c65d061c2c4890ad3b886f29e0a7a5

معادلة التفاعل

COc1cc2nccc(Cl)c2cc1OC
4-Chloro-6,7-dimethoxyquinoline
CCOC(=O)c1ccccc1O
ethyl salicylate
CCOC(=O)c1ccccc1Oc1ccnc2cc(OC)c(OC)cc12
title compound
المردود 63.3%
CCOC(=O)c1ccccc1Oc1ccnc2cc(OC)c(OC)cc12
Ethyl 2-[(6,7-dimethoxy-4-quinolyl)oxy]benzoate
المردود 63.3%

المذيبات

ظروف التفاعل

درجة الحرارة
120°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةThe reaction solution was cooled to room temperature
  2. 2
    أخرىthe solvent was removed by distillation under the reduced pressure
  3. 3
    workup.ADDITIONWater was then added to the residue
  4. 4
    استخلاصthe mixture was extracted with chloroform
  5. 5
    غسيلThe chloroform layer was washed with water
  6. 6
    تجفيفwas dried over anhydrous sodium sulfate
  7. 7
    أخرىThe solvent was removed
  8. 8
    workup.DISTILLATIONby distillation under the reduced pressure
  9. 9
    أخرىthe residue was purified by column chromatography

الإجراء التجريبي

4-Chloro-6,7-dimethoxyquinoline (100 mg), ethyl salicylate (336 mg), and 4-dimethylaminopyridine (244 mg) were suspended in o-dichlorobenzene (1 ml), and the suspension was stirred at 120° C. overnight. The reaction solution was cooled to room temperature, and the solvent was removed by distillation under the reduced pressure. Water was then added to the residue, and the mixture was extracted with chloroform. The chloroform layer was washed with water and was dried over anhydrous sodium sulfate. The solvent was removed therefrom by distillation under the reduced pressure, and the residue was purified by column chromatography using acetone-hexane to give the title compound (100 mg, yield 56%).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07560558B2uspto-grants-2009_07