تفاعل #3152

ord-9102e88c394640fc8efd773b9c3e0835

معادلة التفاعل

[O-2].[O-2].[Ti+4]
titanium dioxide
[O-2].[O-2].[Ti+4]
titanium dioxide
O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
phosphorus pentoxide
[O-2].[O-2].[Ti+4]
titanium dioxide
O=P(O)(O)O
phosphoric acid
O=P12OP3(=O)OP(=O)(O1)OP(=O)(O2)O3
phosphorus pentoxide
O=P([O-])([O-])OP(=O)([O-])[O-].[Ti+4]
titanium pyrophosphate

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.ADDITIONThe reactants are thoroughly mixed
  2. 2
    درجة الحرارةheated at temperatures of about 400° C. to about 500° C.

الإجراء التجريبي

The method of the present invention generally involves the mixture of titanium dioxide and hot concentrated phosphoric acid in a reaction vessel. The reaction mixture has a phosphorus pentoxide to titanium dioxide mole ratio greater than one. Preferably, the phosphorus pentoxide to titanium dioxide mole ratio is about 1.06 or more, and most preferably about 1.20 to about 1.25. The reactants are thoroughly mixed and heated at temperatures of about 400° C. to about 500° C. to produce a fine titanium pyrophosphate powder having a significantly higher fines yield over conventional titanium pyrophosphate processes. The fines yield is greater than 90% when using a phosphorus pentoxide to titanium dioxide mole ratio of about 1.20 to about 1.25.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05733519uspto-grants-1998_03