تفاعل #313395

ord-102b0fd138274c048ebe5de232edecef

معادلة التفاعل

[Cl-].[NH4+]
ammonium chloride
COc1cccc(CN)c1
3-methoxybenzylamine
CC(C)(C)OC(=O)N[C@H](Cc1ccc(F)c(F)c1)[C@H]1CO1
(1R,2S)-[2-(3,4-difluoro-phenyl)-1-oxiranyl-ethyl]-carbamic acid tert-butyl ester
O=S(=O)([O-])C(F)(F)F.[Li+]
lithium triflate
COc1cccc(CNC[C@@H](O)[C@H](Cc2ccc(F)c(F)c2)NC(=O)OC(C)(C)C)c1
(1S,2R)-[1-(3,4-Difluoro-benzyl)-2-hydroxy-3-(3-methoxy-benzylamino)-propyl]-carbamic acid tert-butyl ester

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.STIRRINGThe reaction was stirred at ambient temperature for 14 hours
  2. 2
    استخلاصextracted with ethyl acetate
  3. 3
    أخرىthe organic phase separated
  4. 4
    تجفيفdried (MgSO4)
  5. 5
    أخرىthe solvent removed at reduced pressure
  6. 6
    أخرىThe product was obtained as an oil
  7. 7
    أخرىused without further purification (0.041 g, 94%)

الإجراء التجريبي

A solution of (1R,2S)-[2-(3,4-difluoro-phenyl)-1-oxiranyl-ethyl]-carbamic acid tert-butyl ester (0.03 g, 0.1 mmol) in acetonitrile (1 mL) was treated with lithium triflate (0.032 g, 0.2 mmol) and stirred at ambient temperature for 20 minutes. Then 3-methoxybenzylamine (0.016 mL, 0.12 mmol) was added to the reaction neat in one portion. The reaction was stirred at ambient temperature for 14 hours. The reaction was poured into saturated ammonium chloride solution (5 mL), extracted with ethyl acetate, the organic phase separated, dried (MgSO4) and the solvent removed at reduced pressure. The product was obtained as an oil and used without further purification (0.041 g, 94%). MS: 437 (M+H, 100%).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07557137B2uspto-grants-2009_07