تفاعل #308389

ord-959ed1f655d6420faab0d131d8ab6c6d

معادلة التفاعل

O=C(Cl)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4,5-dihydro-pyrazole-3-carboxylic acid chloride
NN1CCCCC1
N-Aminopiperidine
CCN(CC)CC
triethylamine
O=C(NN1CCCCC1)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1
title compound
O=C(NN1CCCCC1)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1
5-(4-Chloro-phenyl)-1-(2,4-dichloro-phenyl)-4,5-dihydro-1H-pyrazole-3-carboxylic acid piperidin-1-ylamide

ظروف التفاعل

درجة الحرارة
25°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىwas -cooled to 0° C.
  2. 2
    أخرىThe resulting reaction mixture
  3. 3
    غسيلThe reaction mixture was washed with water
  4. 4
    تجفيفdried over sodium sulfate
  5. 5
    ترشيحfiltered
  6. 6
    أخرىevaporated to dryness in a rotavapor
  7. 7
    أخرىThe resulting crude solid was crystallised from ethanol
  8. 8
    أخرىThe crystallised solid was removed via filtration
  9. 9
    تركيزthe mother liquors were concentrated
  10. 10
    أخرىto yield a second fraction of crystallised product
  11. 11
    أخرىto give

الإجراء التجريبي

N-Aminopiperidine (0.6 mL, 5.6 mmol) and triethylamine (4 mL) were dissolved in methylene chloride (25 mL) under nitrogen atmosphere. The resulting mixture was -cooled to 0° C. and a solution of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4,5-dihydro-pyrazole-3-carboxylic acid chloride in methylene chloride (15 mL) was added drop wise. The resulting reaction mixture was stirred at room temperature (approximately 25° C.) overnight. The reaction mixture was washed with water, followed by a saturated aqueous solution of sodium bicarbonate, again with water, dried over sodium sulfate, filtered and evaporated to dryness in a rotavapor. The resulting crude solid was crystallised from ethanol. The crystallised solid was removed via filtration and the mother liquors were concentrated to yield a second fraction of crystallised product. The two fractions were combined to give a total amount of 1.7 g (57% of theoretical yield) of the title compound having a melting point of 183-186° C.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08207156B2uspto-grants-2012_06