تفاعل #2572

ord-06bcb6d3c8c846a7a6b2788898b644c4

معادلة التفاعل

[Na+].[OH-]
sodium hydroxide
Cl
hydrochloric acid
[Sn]
tin
COc1ccccc1N(CCN1CCC(C(=O)c2ccc(F)cc2)CC1)C(=O)c1ccc([N+](=O)[O-])cc1
4-Nitro-N-{2-[4-(4-fluorobenzoyl)piperidino]ethyl}-N-(2-methoxyphenyl)benzamide
COc1ccccc1N(CCN1CCC(C(=O)c2ccc(F)cc2)CC1)C(=O)c1ccc(N)cc1
title compound
المردود 98.3%
COc1ccccc1N(CCN1CCC(C(=O)c2ccc(F)cc2)CC1)C(=O)c1ccc(N)cc1
4-Amino-N-{2[4-(4-fluorobenzoyl)piperidino]ethyl}-N-(2-methoxy-phenyl)benzamide
المردود 98.3%

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةwhile cooling in an ice bath
  2. 2
    أخرىto remove insoluble materials
  3. 3
    غسيلThe resulting residue was washed with chloroform
  4. 4
    استخلاصthe filtrate was extracted with chloroform
  5. 5
    غسيلthe resulting organic layer was washed with water and saturated brine
  6. 6
    تجفيفdried on anhydrous sodium sulfate
  7. 7
    أخرىThereafter, the solvent was removed by evaporation
  8. 8
    أخرىthe resulting residue was purified by a silica gel column chromatography (chloroform:methanol=10:1)

الإجراء التجريبي

4-Nitro-N-{2-[4-(4-fluorobenzoyl)piperidino]ethyl}-N-(2-methoxyphenyl)benzamide (264.0 mg, 0.52 mmol) was dissolved in methanol (5 ml) to which were subsequently added concentrated hydrochloric acid (2.0 ml) and tin (powder, 186.0 mg, 1.57 mmol) while cooling in an ice bath. After 1 hour of stirring at room temperature, the reaction solution was poured in ice water, adjusted to pH 9 to 10 with 10% sodium hydroxide aqueous solution, mixed with chloroform and then passed through cerite to remove insoluble materials. The resulting residue was washed with chloroform, the filtrate was extracted with chloroform, and the resulting organic layer was washed with water and saturated brine, and dried on anhydrous sodium sulfate. Thereafter, the solvent was removed by evaporation, and the resulting residue was purified by a silica gel column chromatography (chloroform:methanol=10:1) to obtain 243.0 mg (97.9%) of the title compound in a colorless amorphous form.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05728835uspto-grants-1998_03