تفاعل #2564

ord-1362f36b27ab4a15833b7044edb1e473

معادلة التفاعل

[H-].[Na+]
sodium hydride
COCc1ccc(C(=O)Nc2ccccc2OC)cc1
4-methoxymethyl-N-(2-methoxyphenyl)benzamide
Cl.O=C(c1ccc(F)cc1)C1CCN(CCCl)CC1
1-(2-chloroethyl)-4-(4-fluorobenzoyl)piperidine hydrochloride
[I-].[Na+]
sodium iodide
COCc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc2OC)cc1
title compound
المردود 54.7%
COCc1ccc(C(=O)N(CCN2CCC(C(=O)c3ccc(F)cc3)CC2)c2ccccc2OC)cc1
N-{2-[4-(4-fluorobenzoyl)piperidino]ethyl}-4-methoxymethyl-N-(2-methoxyphenyl)benzamide
المردود 54.7%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىat room temperature
  2. 2
    workup.WAITat 60° C. for 3.5 hours
  3. 3
    أخرىDMF was removed by evaporation
  4. 4
    workup.ADDITIONThe resulting residue was diluted with water (10 ml)
  5. 5
    استخلاصextracted with ethyl acetate
  6. 6
    غسيلthe organic layer was washed with water and saturated brine
  7. 7
    تجفيفdried on anhydrous sodium carbonate
  8. 8
    أخرىThereafter, the solvent was removed by evaporation
  9. 9
    أخرىthe resulting residue was purified

الإجراء التجريبي

In an atmosphere of argon, 4-methoxymethyl-N-(2-methoxyphenyl)benzamide (126 mg, 0.464 mmol), 1-(2-chloroethyl)-4-(4-fluorobenzoyl)piperidine hydrochloride (157 mg, 0.511 mmol) and sodium iodide (154 mg, 1.02 mmol) were dissolved in DMF (3 ml) to which was subsequently added sodium hydride (40 mg, 60%, 1.0 mmol) at room temperature. After stirring at room temperature for 10 minutes and then at 60° C. for 3.5 hours, DMF was removed by evaporation. The resulting residue was diluted with water (10 ml) and extracted with ethyl acetate, and the organic layer was washed with water and saturated brine and then dried on anhydrous sodium carbonate. Thereafter, the solvent was removed by evaporation, and the resulting residue was purified by subjecting it to a silica gel column chromatography (methylene chloride:methanol=80:1-ethyl acetate) to obtain 128 mg (54.7%) of the title compound in the form of colorless oil.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05728835uspto-grants-1998_03