تفاعل #2487413

ord-6c62d8a076e846ec83fa9afaecc2534c

معادلة التفاعل

CCN(CC)C(=S)S
Diethyldithiocarbamic acid
[Na]
sodium
O=C(O)c1ccc(CCl)cc1
4-Chloromethylbenzoic acid
NC(=O)O
carbamic acid
CCN(CC)C(=S)SCC1(C(=O)O)C=CC=CC1
1-((diethylcarbamothioylthio)methyl)benzoic Acid
المردود 62.0%

المذيبات

ظروف التفاعل

درجة الحرارة
45°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.STIRRINGstirred overnight at r.t
  2. 2
    أخرىThe reaction mixture was then evaporated to dryness
  3. 3
    أخرىseparated between dichloromethane and brine
  4. 4
    أخرىThe aqueous layer was separated
  5. 5
    أخرىThe precipitate that formed on acidification
  6. 6
    ترشيحwas filtered
  7. 7
    أخرىair-dried
  8. 8
    أخرىto give a white solid, 4.1 g (yield 62%)

الإجراء التجريبي

4-Chloromethylbenzoic acid (4 g, 0.0234 mol, 1.0 equiv.) was dissolved in warm ethanol (20 mL). Diethyldithiocarbamic acid, sodium salt trihydrate (7.92 g, 0.0328 mol, 1.5 equiv.) was also separately dissolved in warm ethanol (20 mL). The solution of the carbamic acid was then added to the solution of the carboxylic acid. The resulting mixture was then stirred at 40-50° C. for 2 h, then stirred overnight at r.t. The reaction mixture was then evaporated to dryness and separated between dichloromethane and brine. The aqueous layer was separated and acidified with conc. HCl to a pH value of 2. The precipitate that formed on acidification was filtered and air-dried to give a white solid, 4.1 g (yield 62%). 1H NMR (acetone-d6, 400 MHz) δ 1.26, br. s, 6H, 2×CH3; 3.82, br. s, 2H, CH2N, 4.5, br. s, 2H, CH2N, 4.67, s, 2H, CH2S; 7.56 (d, J=8 Hz, 2H, aromatic); 7.98 (d, J=8 Hz, 2H, aromatic) ppm. 13C NMR (acetone-d6, 400 MHz) δ 11.78, 12.98, 41.53, 47.55, 50.45, 130.26, 130.45, 130.69, 143.74, 167.40, 194.94 ppm.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08795782B2uspto-grants-2014_08