تفاعل #2467942

ord-727fd310fe214d09987931d38cabf0e6

معادلة التفاعل

COC(=O)C(Cc1ccccc1)NC(=O)c1nc(-c2ccccc2)cs1
3-Phenyl-2-[(4-phenyl-thiazole-2-carbonyl)-amino]-propionic acid methyl ester
[K+].[OH-]
KOH
O=C(NC(Cc1ccccc1)C(=O)O)c1nc(-c2ccccc2)cs1
3-Phenyl-2-[(4-phenyl-thiazole-2-carbonyl)-amino]-propionic acid
المردود 83.7%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىAfter the solvent was evaporated from the reaction mixture
  2. 2
    workup.DISSOLUTIONthe residue was dissolved
  3. 3
    workup.ADDITIONby adding water
  4. 4
    أخرىThe produced precipitates
  5. 5
    ترشيحwere filtered with suction
  6. 6
    غسيلwashed with water

الإجراء التجريبي

To a solution of 3-Phenyl-2-[(4-phenyl-thiazole-2-carbonyl)-amino]-propionic acid methyl ester (74 mg, 0.2 mmol) dissolved in ethanol (4 mL) was added 1N—KOH (0.5 mL, 0.5 mmol) and the mixture was stirred at room temperature for 2 hours. After the solvent was evaporated from the reaction mixture, the residue was dissolved by adding water and acidified (H=2) with 2N—HCl under ice cooling. The produced precipitates were filtered with suction, washed with water to afford 59 mg (yield 80%) of the desired 3-Phenyl-2-[(4-phenyl-thiazole-2-carbonyl)-amino]-propionic acid as white solids.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08257931B2uspto-grants-2012_09