تفاعل #2358490

ord-acfe27147c714dbf9aa70e020235efe9

معادلة التفاعل

O=C(Cl)C(=O)Cl
oxalyl chloride
O=C(O)c1cc2cc(C(F)(F)F)ccc2s1
5-(trifluoromethyl)benzo[b]thiophene-2-carboxylic acid
CCOC(=O)c1cc2cc(C(F)(F)F)ccc2s1
ethyl 5-(trifluoromethyl)benzo[b]thiophene-2-carboxylate
المردود 74.1%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةcooling
  2. 2
    درجة الحرارةunder reflux
  3. 3
    تركيزconcentrated under reduced pressure
  4. 4
    workup.ADDITIONTo the residue was added chloroform
  5. 5
    غسيلthe organic layer was washed with saturated aqueous sodium bicarbonate solution and saturated aqueous sodium chloride solution
  6. 6
    تجفيفdried over magnesium sulfate
  7. 7
    تركيزconcentrated under reduced pressure

الإجراء التجريبي

Then, 254 mg of oxalyl chloride was added to a mixture of 400 mg of 5-(trifluoromethyl)benzo[b]thiophene-2-carboxylic acid and 20 ml of ethanol while ice-cooling, and the mixture was stirred for 6 hours under reflux. The reaction mixture was cooled to room temperature, and then concentrated under reduced pressure. To the residue was added chloroform, and then the organic layer was washed with saturated aqueous sodium bicarbonate solution and saturated aqueous sodium chloride solution, dried over magnesium sulfate, and then concentrated under reduced pressure to obtain 330 mg of ethyl 5-(trifluoromethyl)benzo[b]thiophene-2-carboxylate (the present compound 5).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US09119396B2uspto-grants-2015_09