تفاعل #2348079

ord-e020af15dcf4458c83eeff68a9086692

معادلة التفاعل

CC(C)=CCCC(C)=CCCC(C)=CCO
Farnesol
CC(C)CCCC(C)CCCC(C)CCO
3,7,11-trimethyldodecan-1-ol

المتفاعلات

الكواشف

ظروف التفاعل

درجة الحرارة
25°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىThe reaction vessel was sealed
  2. 2
    أخرىevacuated under house vacuum for 5 minutes after which time the reaction mixture
  3. 3
    أخرىThe reaction contents
  4. 4
    ترشيحfiltered over a silica gel (60 {acute over (Å)} from Aldrich) pad
  5. 5
    غسيلby washing of the silica gel with ethyl acetate (“EtOAc”, 3 L)
  6. 6
    تركيزThe filtrate was concentrated on a rotary evaporator
  7. 7
    أخرىThe isolated product was further dried under high vacuum
  8. 8
    أخرىto remove any residual EtOAc

الإجراء التجريبي

Farnesol (572 g, 2.58 mole, 650 mL) was added to a 1000 mL Parr high pressure vessel containing 10% Pd/C (23 g, 4% by weight of farnesol). The reaction vessel was sealed and evacuated under house vacuum for 5 minutes after which time the reaction mixture was pressurized with H2 to 1000 psi. The reaction mixture was stirred at 25° C. and judged to be complete by thin layer chromatography (“TLC”, Rf=0.32, 90:10 hexane:ethyl acetate) after approximately 12 hours. The reaction vessel was depressurized under vacuum followed by venting to a N2 atmosphere. The reaction contents were vacuum filtered over a silica gel (60 {acute over (Å)} from Aldrich) pad followed by washing of the silica gel with ethyl acetate (“EtOAc”, 3 L). The filtrate was concentrated on a rotary evaporator. The isolated product was further dried under high vacuum to remove any residual EtOAc to afford 3,7,11-trimethyldodecan-1-ol as a lightly tinted yellow viscous liquid. 1H-NMR (CDCl3, 500 MHz): δ 3.71(m, 2H), 1.65-1.05 (m, 17H), 0.89-0.83 (overlapping t&d, 12H).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07846222B2uspto-grants-2010_12