تفاعل #2307971

ord-62aa3bd72c4b4c32b0af22b6152624ae

معادلة التفاعل

O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
Glucose
O=C([O-])[O-].[Na+].[Na+]
sodium carbonate
O=C(O)CCC(=O)O
succinic acid
O=C(O)CC(O)C(=O)O
malic acid

الكواشف

لا شيء

ظروف التفاعل

درجة الحرارة
33°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىThe coryneform bacterium cells prepared after culturing
  2. 2
    workup.ADDITIONwere added to 500 ml of the reaction stock solution in a reaction container under the nitrogen gas atmosphere
  3. 3
    أخرىproducing an organic compound
  4. 4
    أخرىafter the initiation of the reaction
  5. 5
    درجة الحرارةby maintaining the oxidation-reduction potential at −400 mV
  6. 6
    أخرىAfter the reaction for 3 hours

الإجراء التجريبي

The coryneform bacterium cells prepared after culturing were added to 500 ml of the reaction stock solution in a reaction container under the nitrogen gas atmosphere. Glucose 200 mM and sodium carbonate 200 mM were added, and the reaction temperature was maintained at 33° C. to perform a reaction producing an organic compound. An oxidation-reduction potential was initially −200 mV, but was reduced immediately after the initiation of the reaction, and the reaction was continued by maintaining the oxidation-reduction potential at −400 mV. After the reaction for 3 hours, the reaction medium solution was analyzed by liquid chromatography, indicating that succinic acid 163 mM (19.2 g/L) and malic acid 5 mM (0.67 g/L) were produced. Lactic acid was not detected.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07368268B2uspto-grants-2008_05