تفاعل #2286376

ord-e5902e172a7a4078b461d3dd1092e217

معادلة التفاعل

CCN(CC)CC
Et3N
NC(=S)c1cccnc1
thionicotinamide
CCOC(=O)C(Cl)C(=O)C(F)(F)F
2-chloro-4,4,4-trifluoro-3-oxo-butyric acid ethyl ester
CCOC(=O)c1sc(-c2cccnc2)nc1C(F)(F)F
desired product
CCOC(=O)c1sc(-c2cccnc2)nc1C(F)(F)F
2-pyridin-3-yl-4-trifluoromethyl-thiazole-5-carboxylic acid ethyl ester

المذيبات

ظروف التفاعل

درجة الحرارة
150°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىThe tube was capped
  2. 2
    درجة الحرارةThe reaction mixture was cooled to ambient temperature
  3. 3
    أخرىThe tube was capped
  4. 4
    درجة الحرارةheated in a microwave at 130° C. for 1 min
  5. 5
    درجة الحرارةAfter cooling to ambient temperature the solvent
  6. 6
    أخرىwas evaporated
  7. 7
    أخرىthe crude reaction mixture

الإجراء التجريبي

To a 20 mL microwave tube was added thionicotinamide (0.552 g, 4.0 mmol), ethanol (15 mL) and 2-chloro-4,4,4-trifluoro-3-oxo-butyric acid ethyl ester (1.75 g, 8 mmol). The tube was capped and heated in a microwave at 150° C. for 10 min. The reaction mixture was cooled to ambient temperature and Et3N (1.7 mL, 12 mmol) was added. The tube was capped and heated in a microwave at 130° C. for 1 min. After cooling to ambient temperature the solvent was evaporated and the crude reaction mixture was directly subjected to silica gel chromatography (0 to 100% ethyl acetate/hexanes) to give the desired product as an orange oil which subsequently solidified (0.885 g, 73%): IR (KBr) 2988, 1737, 1712 cm−1; 1H NMR (300 MHz, CDCl3) δ 9.21 (dd, J=2.5, 0.8 Hz, 1H), 8.77 (dd, J=5.0, 1.7 Hz, 1H), 8.33 (dt, J=8.0, 2.2 Hz, 1H), 7.47 (ddd, J=11.8, 4.7, 0.8 Hz, 1H), 4.45 (q, J=14.3, 7.1 Hz, 2H), 1.44 (t, J=7.1 Hz, 3H); ESIMS m/z 303 (M+1).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US09357780B2uspto-grants-2016_06