تفاعل #2275720

ord-49088874da784ab89d826d849b46d841

معادلة التفاعل

CCOC(=O)CNCC(=O)c1ncccc1O
[(3-hydroxy-pyridine-2-carbonyl)methylamino]acetic acid ethyl ester
O
H2O
[Na+].[OH-]
NaOH
CN(CC(=O)O)C(=O)c1ncccc1O
desired compound
المردود 85.0%
CN(CC(=O)O)C(=O)c1ncccc1O
[(3-hydroxy-pyridine-2-carbonyl)-methyl-amino]-acetic acid
المردود 85.0%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    تركيزthen concentrated under reduced pressure
  2. 2
    تركيزthe solution is concentrated under reduced pressure
  3. 3
    أخرىto give an off-white solid
  4. 4
    ترشيحthen collected by filtration
  5. 5
    غسيلThe solid is washed with additional CHCl3:isopropanol (1:1)
  6. 6
    أخرىthen transferred to a flask
  7. 7
    أخرىtriturated with Et2O

الإجراء التجريبي

To a solution of [(3-hydroxy-pyridine-2-carbonyl)methylamino]acetic acid ethyl ester, 32, (0.10 g, 0.42 mmol) in THF (4 mL) is added H2O (1 mL) and NaOH (0.90 g, 2.25 mmol). The reaction is stirred for 3 hours then concentrated under reduced pressure. The remaining oil is acidified to pH ˜1 with 1M HCl and the solution is concentrated under reduced pressure to give an off-white solid. The solid is suspended in CHCl3:isopropanol (1:1) then collected by filtration. The solid is washed with additional CHCl3:isopropanol (1:1) then transferred to a flask and triturated with Et2O to afford 0.075 g (85% yield) of the desired compound as a pale yellow solid. 1H NMR (250 MHz, MeOD) δ ppm (rotamers) 8.26 (1H, br s), 7.63-7.74 (1H, m), 7.56-7.63 (1H, m), 4.38 (1H, s), 4.32 (1H, s), 3.20 (1.5H, s), 3.12 (1.5H, s). HPLC-MS: m/z 211 [M+H]+.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08323671B2uspto-grants-2012_12