تفاعل #2275718

ord-78feb1b91b8948919050f0b08c80c20d

معادلة التفاعل

COC(=O)c1ccc(Br)cc1OC
methyl 4-bromo-2-methoxybenzoate
OB(O)c1ccc(Cl)cc1
4-chlorophenyl boronic acid
O=P([O-])([O-])[O-].[K+].[K+].[K+]
K3PO4
COC(=O)c1ccc(-c2ccc(Cl)cc2)cc1OC
desired compound
المردود 78.0%
COC(=O)c1ccc(-c2ccc(Cl)cc2)cc1OC
4′-chloro-3-methoxy-biphenyl-4-carboxylic acid methyl ester
المردود 78.0%

المذيبات

ظروف التفاعل

درجة الحرارة
80°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةAfter this time, the reaction is cooled to room temperature
  2. 2
    ترشيحfiltered through Celite™
  3. 3
    أخرىThe solids that form are collected
  4. 4
    غسيلwashed with additional MeOH before the filtrate
  5. 5
    تركيزis concentrated under reduced pressure
  6. 6
    أخرىThe crude material is purified over silica (hexanes:EtOAc; 6:1 to 4:1)

الإجراء التجريبي

To a degassed solution of methyl 4-bromo-2-methoxybenzoate (0.70 g, 2.86 mmol) in 1,4-dioxane (10 mL) and MeOH (2.5 mL) is added 4-chlorophenyl boronic acid (0.536 g, 3.43 mmol), Pd(dppf)Cl2 (0.233 g, 0.286 mmol) and K3PO4 (0.728 g, 3.43 mmol). The resulting suspension is heated to 80° C. and stirred for 3 hours. After this time, the reaction is cooled to room temperature and filtered through Celite™. The solids that form are collected and washed with additional MeOH before the filtrate is concentrated under reduced pressure. The crude material is purified over silica (hexanes:EtOAc; 6:1 to 4:1) to provide 0.615 g (78% yield) of the desired compound as orange crystals. 1H NMR (400 MHz, CDCl3) δ ppm 7.89 (1H, d, J=8.0 Hz), 7.52-7.56 (2H, m), 7.44 (2H, d, J=8.7 Hz), 7.17 (1H, d, J=8.0 Hz), 7.12 (1H, d, J=1.6 Hz), 3.99 (3H, s), 3.92 (3H, s). HPLC-MS: m/z 277 [M+H]+.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08323671B2uspto-grants-2012_12