تفاعل #2275683

ord-698cbab603854742b1347453baeb6691

معادلة التفاعل

CNc1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I
2,4,6-Triiodo-5-methylamino-isophthaloyl dichloride
CC(=O)OCC(=O)Cl
acetoxyacetyl chloride
CC(=O)OCC(=O)N(C)c1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I
acetic acid [(3,5-bis-chlorocarbonyl-2,4,6-triiodo-phenyl)-methyl-carbamoyl]-methyl ester
المردود 69.8%

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.ADDITIONThe reaction mixture was poured slowly onto ice-water (300 ml)
  2. 2
    أخرىa white solid was isolated by filtration
  3. 3
    غسيلwashed with water
  4. 4
    أخرىThe ethyl acetate was collected
  5. 5
    تجفيفdried over MgSO4
  6. 6
    ترشيحfiltered
  7. 7
    أخرىevaporated
  8. 8
    أخرىto give a white solid
  9. 9
    أخرىThis was purified by silica column chromatography
  10. 10
    غسيلeluting with petrol

الإجراء التجريبي

2,4,6-Triiodo-5-methylamino-isophthaloyl dichloride (20 g, 32.8 mmol) was dissolved in DMA (60 ml) and acetoxyacetyl chloride (15.32 ml, 142 mmol) was added. The reaction was stirred overnight at room temperature with nitrogen bubbling through the reaction mixture. The reaction mixture was poured slowly onto ice-water (300 ml) and a white solid was isolated by filtration. The solid was dissolved in ethyl acetate and washed with water. The ethyl acetate was collected, dried over MgSO4, filtered and evaporated to give a white solid. This was purified by silica column chromatography eluting with petrol:ethyl acetate to give acetic acid [(3,5-bis-chlorocarbonyl-2,4,6-triiodo-phenyl)-methyl-carbamoyl]-methyl ester (16.25 g, 22.9 mmol).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08323619B2uspto-grants-2012_12