تفاعل #2271

ord-351246f0dd44448ebbd806606156bbea

معادلة التفاعل

O=C([O-])[O-].[K+].[K+]
potassium carbonate
O=P(Cl)(Cl)Cl
Phosphorus oxychloride
CN(C)C=O
DMF
O=C(O)Cc1ccc(Cl)cc1
4-chlorophenylacetic acid
CN(C)C=C(C=O)c1ccc(Cl)cc1
2-(4-chlorophenyl)-3-dimethylaminopropenal

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةheated to 70°-80° C. during 5.5 hours, during which time the mixture
  2. 2
    درجة الحرارةThe reaction mixture was cooled
  3. 3
    workup.ADDITIONpoured slowly
  4. 4
    workup.ADDITIONIce was added intermittently during this addition
  5. 5
    درجة الحرارةto maintain the temperature below 15° C
  6. 6
    درجة الحرارةthe resulting mixture heated at 100° C. for one hour
  7. 7
    درجة الحرارةThe mixture was cooled
  8. 8
    أخرىThe two resulting layers were separated
  9. 9
    استخلاصthe aqueous layer extracted with toluene (2×100 ml)
  10. 10
    غسيلThe combined organic layers were washed with water (5×200 ml)
  11. 11
    تجفيفdried over anhydrous sodium sulfate
  12. 12
    أخرىThe solvent was evaporated in vacuo
  13. 13
    أخرىthe resulting yellow solid was triturated with hexane

الإجراء التجريبي

Phosphorus oxychloride (92 g) was added dropwise to stirred DMF (78 ml) between 10°-15° C. To the resulting slurry was added 4-chlorophenylacetic acid (34.12 g). The resulting mixture was stirred at room temperature for one half hour and then heated to 70°-80° C. during 5.5 hours, during which time the mixture became effervescent. The reaction mixture was cooled and poured slowly onto cracked ice. The resulting suspension was brought to pH 10 with solid potassium carbonate. Ice was added intermittently during this addition to maintain the temperature below 15° C. Toluene (150 ml) was added and the resulting mixture heated at 100° C. for one hour. The mixture was cooled and allowed to stand overnight. The two resulting layers were separated and the aqueous layer extracted with toluene (2×100 ml). The combined organic layers were washed with water (5×200 ml) and dried over anhydrous sodium sulfate. The solvent was evaporated in vacuo and the resulting yellow solid was triturated with hexane to yield 26 g of 2-(4-chlorophenyl)-3-dimethylaminopropenal as a tan solid mp. 120°-125° C.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05728715uspto-grants-1998_03