تفاعل #2269252

ord-8257da7cc0904590825df7d52a214703

معادلة التفاعل

Nc1c(Br)cc(C(F)(F)F)cc1Br
4-amino-3,5-dibromobenzotrifluoride
CC(=O)C(C)O
acetoin
N#CCC#N
malononitrile
Cc1c(C#N)c(N)n(-c2c(Br)cc(C(F)(F)F)cc2Br)c1C
2-amino-4,5-dimethyl-1-(2,6-dibromo-4-trifluoromethylphenyl)pyrrole-3-carbonitrile
المردود 15.9%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةThe reaction solution was heated
  2. 2
    درجة الحرارةunder reflux for 2.5 hours
  3. 3
    درجة الحرارةThe reaction mixture was heated for 4 hours
  4. 4
    تركيزwhile being concentrated at 180° C
  5. 5
    workup.ADDITIONWater was added to the reaction mixture
  6. 6
    استخلاصThe reaction mixture was extracted with chloroform
  7. 7
    تجفيفsubsequently, the extract was dried over anhydrous sodium sulfate
  8. 8
    ترشيحAfter the desiccant was filtered off
  9. 9
    تركيزthe filtrate was concentrated under reduced pressure
  10. 10
    أخرىThe residue was purified by silica gel column chromatography (eluent: hexane-ethyl acetate=5:1)
  11. 11
    أخرىto stand for crystallization

الإجراء التجريبي

In 15 ml of toluene, 5.5 g of 4-amino-3,5-dibromobenzotrifluoride, 1.9 g of acetoin, and 34 mg of p-toluenesulfonic acid were dissolved. The reaction solution was heated under reflux for 2.5 hours while conducting azeotropic dehydration. To the reaction mixture, 1.42 g of malononitrile was added. The reaction mixture was heated for 4 hours while being concentrated at 180° C. Water was added to the reaction mixture. The reaction mixture was extracted with chloroform, and subsequently, the extract was dried over anhydrous sodium sulfate. After the desiccant was filtered off, the filtrate was concentrated under reduced pressure. The residue was purified by silica gel column chromatography (eluent: hexane-ethyl acetate=5:1), and was allowed to stand for crystallization to yield 1.2 g of 2-amino-4,5-dimethyl-1-(2,6-dibromo-4-trifluoromethylphenyl)pyrrole-3-carbonitrile.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US06894168B2uspto-grants-2005_05