تفاعل #2175483

ord-b5e0207cc3a54d4d84d1187d2f29c117

معادلة التفاعل

O
water
CCCCCCOC(C)(COS(=O)(=O)[O-])OCCCCCC.[Na+]
methyl pyruvate
CCCCCCOC(C)(COS(=O)(=O)[O-])OCCCCCC.[Na+]
sodium 2,2-bis(hexyloxy)propyl sulfate
CCCCCCO
1-hexanol
CCCCCCOC(=O)C(C)(OCCCCCC)OCCCCCC
hexyl 2,2-bis(hexyloxy)propanoate
المردود 84.0%

الكواشف

لا شيء

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةThe mixture is heated
  2. 2
    أخرىThe reaction is quenched with saturated NaHCO3 (100 mL)
  3. 3
    استخلاصthe reaction mixture is extracted with ethyl acetate (2×100 mL)
  4. 4
    غسيلThe combined organic layers are washed with brine (100 mL)
  5. 5
    تجفيفdried over anhydrous sodium sulfate
  6. 6
    أخرىThe solvent is removed
  7. 7
    أخرىthe residue is purified by silica gel chromatography (1→10% ethyl acetate/hexane)

الإجراء التجريبي

To a solution of methyl pyruvate 1 (10.0 g, 98.0 mmol) in toluene (100 mL) is added 1-hexanol 2 (40.1 g, 392 mmol) and p-Ts0H (186 mg, 0.98 mmol). The mixture is heated to reflux for 10 hours with azeotropic removal of water from the reaction mixture. The reaction is quenched with saturated NaHCO3 (100 mL), and the reaction mixture is extracted with ethyl acetate (2×100 mL). The combined organic layers are washed with brine (100 mL) and dried over anhydrous sodium sulfate. The solvent is removed and the residue is purified by silica gel chromatography (1→10% ethyl acetate/hexane) to give hexyl 2,2-bis(hexyloxy)propanoate 3 (29.5 g, 84%) as a colorless oil: Rf (15% EtOAc/hexane)=0.53; IR (thin film, cm−1) 2956, 2930, 2860, 1746 (C═O), 1467, 1280, 1137, 1062. 1H NMR (600 MHz, CDCl3) δ 4.14 (t, J=7.2 Hz, 2H), 3.48 (ddd, J=9.0, 7.2, 6.6 Hz, 2H), 3.35 (ddd, J=9.0, 7.2, 6.6 Hz, 2H), 1.65-1.63 (m, 2H), 1.59-1.54 (m, 4H), 1.49 (s, 3H), 1.35-1.24 (m, 18H), 0.86 (t, J=7.2 Hz, 9H); 13C NMR (150 MHz, CDCl3) δ 170.2, 99.5, 65.4, 62.6, 31.7, 31.3, 29.7, 28.5, 25.8, 25.5, 22.6, 22.5, 21.9, 14.0, 13.9.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08435756B2uspto-grants-2013_05