تفاعل #2175460

ord-29b7cb5316b44fdb94e85cf50ed0bcdc

معادلة التفاعل

O=C(O)CCC(=O)c1ccc2c(c1)Cc1cc(C(=O)CCC(=O)O)ccc1-2
2,7-di(3-carboxy-propionyl)fluorene
Cl
HCl
[Na+].[OH-]
NaOH
NN.O
hydrazine hydrate
O=C(O)CCCc1ccc2c(c1)Cc1cc(CCCC(=O)O)ccc1-2
2,7-di(3-carboxy-propyl)fluorene

ظروف التفاعل

درجة الحرارة
110°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىwas placed in a room temperature
  2. 2
    درجة الحرارةrefluxed for approximately two hours
  3. 3
    أخرىAfter three hours at 200° C. reaction temperature the reaction
  4. 4
    درجة الحرارةwas cooled to approximately 60° C
  5. 5
    ترشيحThe product was filtered
  6. 6
    غسيلwashed with water
  7. 7
    workup.DISSOLUTIONThe product was dissolved in warm NaOH solution (0.5M)
  8. 8
    أخرىprecipitated by acidification to pH 2 with HCl
  9. 9
    ترشيحThe product was filtered
  10. 10
    غسيلwashed with water (Yield 10.9 g, 92%)

الإجراء التجريبي

In an argon-purged flask 2,7-di(3-carboxy-propionyl)fluorene (12.8 g, 0.035 mol) was suspended in diethylene glycol (150 mL). The flask was placed in a room temperature oil bath then NaOH (14 g, 0.35 mol) and an 80% solution of hydrazine hydrate (13.1 mL, 0.21 mol) were added successively. The reaction mixture was slowly heated to 110° C. and refluxed for approximately two hours. The reaction temperature was raised to 200° C. with removal of water during the heating process. After three hours at 200° C. reaction temperature the reaction was cooled to approximately 60° C. The reaction mixture was carefully poured into water (500 mL) and the mixture was acidified to pH 2 with concentrated HCl. The product was filtered and washed with water. The product was dissolved in warm NaOH solution (0.5M) and precipitated by acidification to pH 2 with HCl. The product was filtered and washed with water (Yield 10.9 g, 92%). 1H-NMR (d6-DMSO): δ (ppm) 12.0 (s, 2H, COOH); 7.8 (m, 2H, Ar); 7.4 (s, 2H, Ar); 7.2 (m, 2H, Ar); 3.9 (s, 2H, CH2); 2.7 (t, 4H, CH2); 2.3 (t, 4H, CH2); 1.8 (m, 4H, CH2).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08435505B2uspto-grants-2013_05