تفاعل #2146691

ord-06f06e6015404c9bb4a884deb278daab

معادلة التفاعل

CC(=O)c1ccc(OC(=O)c2ccccc2)cc1
4′-benzoyloxyacetophenone
CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.[Br-].[Br-].[Br-]
tetra-n-butyl ammonium tribromide
O=C(CBr)c1ccc(OC(=O)c2ccccc2)cc1
4′-benzoyloxy-2-bromoacetophenone
المردود 73.5%

الكواشف

لا شيء

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.DISTILLATIONwas distilled off under reduced pressure
  2. 2
    أخرىto remove the solvent
  3. 3
    workup.DISSOLUTIONThe residue was dissolved in ethyl acetate
  4. 4
    غسيلwashed twice with water
  5. 5
    غسيلwashed with an aqueous saturated sodium chloride solution
  6. 6
    تجفيفAfter the ethyl acetate layer was dried over anhydrous sodium sulfate
  7. 7
    تركيزconcentrated under reduced pressure
  8. 8
    أخرىthe resulting crude product was purified by silica gel column chromatography (elution solvent: hexane/methylene chloride=1/1)

الإجراء التجريبي

13.50 g (corresponding to 59.66 mmol) of 4′-benzoyloxyacetophenone was dissolved in 1100 ml of methanol, and 34.52 g (corresponding to 71.59 mmol) of tetra-n-butyl ammonium tribromide was added thereto. The mixture was stirred overnight at room temperature, and was distilled off under reduced pressure to remove the solvent. The residue was dissolved in ethyl acetate and washed twice with water and then washed with an aqueous saturated sodium chloride solution. After the ethyl acetate layer was dried over anhydrous sodium sulfate and concentrated under reduced pressure, the resulting crude product was purified by silica gel column chromatography (elution solvent: hexane/methylene chloride=1/1), to obtain 13.38 g (corresponding to 43.84 mmol) of 4′-benzoyloxy-2-bromoacetophenone (FIG. 3, Step 4).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08277777B2uspto-grants-2012_10