تفاعل #2146689

ord-607571f9c2a748aca1fa898a338aef5f

معادلة التفاعل

O=S(=O)(O)O
sulfuric acid
O=[N+]([O-])O
nitric acid
COc1cccnc1Br
2-bromo-3-methoxypyridine
COc1ccc([N+](=O)[O-])nc1Br
2-bromo-3-methoxy-6-nitropyridine

الكواشف

لا شيء

ظروف التفاعل

درجة الحرارة
55°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.STIRRINGthe mixture was stirred at room temperature for 10 minutes
  2. 2
    workup.STIRRINGfurther stirred for one hour
  3. 3
    درجة الحرارةAfter the reaction solution was cooled to room temperature
  4. 4
    workup.ADDITIONthe reaction solution was poured little by little
  5. 5
    أخرىinto crushed ice
  6. 6
    أخرىto generate precipitates
  7. 7
    ترشيحThe precipitates were filtered
  8. 8
    غسيلwashed with water
  9. 9
    تجفيفdried over phosphorus pentaoxide under reduced pressure

الإجراء التجريبي

83 mL of conc. sulfuric acid was cooled down to −5° C., and 83 mL of 90% nitric acid was carefully added thereto. Subsequently, 20.69 g (corresponding to 110.04 mmol) of 2-bromo-3-methoxypyridine was carefully added thereto. After the reaction mixture was stirred in an ice bath for 5 minutes, the mixture was stirred at room temperature for 10 minutes, and then was heated to 55° C. and further stirred for one hour. After the reaction solution was cooled to room temperature, the reaction solution was poured little by little into crushed ice to generate precipitates. The precipitates were filtered and washed with water, and then dried over phosphorus pentaoxide under reduced pressure, to obtain 17.41 g (corresponding to 74.71 mmol) of 2-bromo-3-methoxy-6-nitropyridine (FIG. 3, Step 2).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08277777B2uspto-grants-2012_10