تفاعل #2068

ord-0d06fa7cb400433aac9523d5cb4e75c0

معادلة التفاعل

CCCCNC(=O)CCl
N-butyl-2-chloroacetamide
[I-].[K+]
potassium iodide
[Cl-].[Na+]
sodium chloride
CCOP(=O)(CP(=O)(OCC)OCC)OCC
Tetraethyl methylenebisphosphonate
[H-].[Na+]
sodium hydride
[H-]
hydride
CCCCNC(=O)CC(P(=O)(OCC)OCC)P(=O)(OCC)OCC
title compound
المردود 70.0%
CCCCNC(=O)CC(P(=O)(OCC)OCC)P(=O)(OCC)OCC
N-butyl-3,3-bis(diethoxyphosphinyl)propionamide
المردود 70.0%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىwas consumed
  2. 2
    أخرىprecipitated
  3. 3
    workup.ADDITIONAdditional sodium hydride (20 mg) was added
  4. 4
    درجة الحرارةthe reaction mixture was heated an additional 4 hours
  5. 5
    درجة الحرارةAfter cooling
  6. 6
    workup.ADDITIONthe mixture was poured into 1N HCl (10 mL) and diethyl ether (50 mL)
  7. 7
    workup.ADDITIONwas added
  8. 8
    استخلاصThe diethyl ether layer was further extracted with water (3×10 mL)
  9. 9
    استخلاصThe combined aqueous fractions were extracted with dichloromethane (4×25 mL)
  10. 10
    تجفيفThe combined extracts were dried (Na2SO4)
  11. 11
    تركيزconcentrated

الإجراء التجريبي

Tetraethyl methylenebisphosphonate (1.44 g, 5.0 mmol) in THF (1 mL) was added to a slurry of 80% sodium hydride (150 mg, 5.0 mmol) in THF (4 mL) at 0° C. The reaction was warmed to room temperature and stirred until all of the hydride was consumed. A solution of N-butyl-2-chloroacetamide (0.75 g, 5.0 mmol) in THF (1 ml) and potassium iodide (100 mg) were then added. The reaction mixture was then heated at 50° C. for 18 hours, during which time sodium chloride precipitated. Additional sodium hydride (20 mg) was added, and the reaction mixture was heated an additional 4 hours. After cooling, the mixture was poured into 1N HCl (10 mL) and diethyl ether (50 mL) was added. The diethyl ether layer was further extracted with water (3×10 mL). The combined aqueous fractions were extracted with dichloromethane (4×25 mL). The combined extracts were dried (Na2SO4) and concentrated to give the title compound (1.40 g, 70%) as an oil.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05728650uspto-grants-1998_03