تفاعل #2045111

ord-ca89fc13e2a14b1f8278ccb967f19dcb

معادلة التفاعل

CCOC(=O)c1cc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)cn1C
ethyl 1-methyl-4-[({[4-(trifluoromethoxy)phenyl]amino}carbonyl)amino]-1H-pyrrole-2-carboxylate
[Li+].[OH-]
lithium hydroxide
Cn1cc(NC(=O)Nc2ccc(OC(F)(F)F)cc2)cc1C(=O)O
1-Methyl-4-[({[4-(trifluoromethoxy)phenyl)amino}carbonyl)amino]-1H-pyrrole-2-carboxylic acid

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةunder reflux overnight
  2. 2
    تركيزThe reaction mixture is concentrated
  3. 3
    أخرىthe precipitate formed
  4. 4
    ترشيحis filtered off with suction
  5. 5
    أخرىdried under reduced pressure
  6. 6
    أخرىThis gives a solid

الإجراء التجريبي

470 mg (1.27 mmol) of ethyl 1-methyl-4-[({[4-(trifluoromethoxy)phenyl]amino}carbonyl)amino]-1H-pyrrole-2-carboxylate are initially charged in 5 ml of THF, 152 mg (6.33 mmol) of lithium hydroxide in 1 ml of water are added and the mixture is stirred under reflux overnight. The reaction mixture is concentrated, the residue is acidified with 2M hydrochloric acid and the precipitate formed is filtered off with suction and dried under reduced pressure. This gives a solid.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08410090B2uspto-grants-2013_04