تفاعل #2018

ord-36f08b8e5c0c4222ab2cf761a8e66449

معادلة التفاعل

CCOC(C)=O
ethyl acetate
C=CCO
allyl alcohol
CC(C)(C)OC(=O)N[C@H](COCc1ccccc1)C(=O)O
N-(t-Butoxycarbonyl)-O-benzyl-D-serine
ClCCCl
EDC
C=CCOC(=O)[C@@H](COCc1ccccc1)NC(=O)OC(C)(C)C
N-(t-Butoxycarbonyl)-O-Benzyl-D-Serine Allyl Ester

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىthe resulting homogeneous solution quenched with water
  2. 2
    استخلاصextracted with methylene chloride
  3. 3
    غسيلThe methylene chloride layer was washed with 5% aqueous citric acid
  4. 4
    تجفيفThe methylene chloride layer was dried over anhydrous magnesium sulfate powder
  5. 5
    ترشيحfiltered
  6. 6
    أخرىevaporated under reduced pressure
  7. 7
    أخرىto give an oil
  8. 8
    أخرىafforded the product (408 mg; 60%) as a pale yellow gum

الإجراء التجريبي

N-(t-Butoxycarbonyl)-O-benzyl-D-serine (600 mg; 2.03 mmol) was dissolved in dry methylene chloride (5 ml), allyl alcohol (152 μl; 2.23 mmol) and DMAP (25 mg; 0.20 mmol) added and finally EDC (428.5 mg; 2.24 mmol) added to the acid. The reaction mixture was stirred at room temperature for 2.5 h and the resulting homogeneous solution quenched with water and extracted with methylene chloride. The methylene chloride layer was washed with 5% aqueous citric acid then 10% aqueous sodium carbonate solution. The methylene chloride layer was dried over anhydrous magnesium sulfate powder, filtered and evaporated under reduced pressure to give an oil. Chromatography of the oil using ethyl acetate and hexanes 1:2 v/v afforded the product (408 mg; 60%) as a pale yellow gum. FAB-MS:- Calculated for C36H33N5 335.1; found 336.1 (M+1).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05726319uspto-grants-1998_03