تفاعل #1951045

ord-181dd5b749dd4638b60d7947e187bb4e

معادلة التفاعل

O=C(O)c1cccnc1
nicotinic acid
O=C([O-])O.[Na+]
sodium bicarbonate
CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])[O-]
tetrabutylammonium sulfate
O=S(=O)(Cl)CCl
chloromethylchlorosulfone
O=C(OCCl)c1cccnc1
chloromethyl pyridine-3-carboxylate
المردود 25.5%

ظروف التفاعل

درجة الحرارة
0°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةto warm to room temperature
  2. 2
    أخرىThe organic layer was separated
  3. 3
    غسيلwashed with brine
  4. 4
    تجفيفdried over sodium sulfate
  5. 5
    تركيزconcentrated under reduced pressure to a yellow oil, which
  6. 6
    workup.DISSOLUTIONwas dissolved in dichloromethane
  7. 7
    ترشيحfiltered through a silica plug
  8. 8
    أخرىRemoval of the solvent under reduced pressure

الإجراء التجريبي

A mixture of nicotinic acid (200 mg, 1.6 mmol), sodium bicarbonate (540 mg, 6.4 mmol), and tetrabutylammonium sulfate (54 mg, 0.16 mmol) was dissolved in a mixture of 4 ml of dichloromethane and 4 ml of water, and cooled to 0° C. To this stirred mixture was added chloromethylchlorosulfone (165 μl, 1.6 mmol) in 1 ml of dichloromethane, and the mixture was allowed to warm to room temperature, stirring overnight. The organic layer was separated, washed with brine, dried over sodium sulfate, and concentrated under reduced pressure to a yellow oil, which was dissolved in dichloromethane and filtered through a silica plug. Removal of the solvent under reduced pressure provided chloromethyl pyridine-3-carboxylate (70 mg).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07625881B2uspto-grants-2009_12