تفاعل #1909783

ord-7ce88c7dda5943938f45e77c9310bb97

معادلة التفاعل

CCOC(=O)C1(CC)CCN(C(=O)OC(C)(C)C)CC1
1-tert-butoxycarbonyl-4-ethylisonipecotic acid ethyl ester
[Li+].[OH-]
lithium hydroxide
CCC1(C(=O)O)CCN(C(=O)OC(C)(C)C)CC1
title compound
المردود 45.3%
CCC1(C(=O)O)CCN(C(=O)OC(C)(C)C)CC1
1-tert-Butoxycarbonyl-4-ethylisonipecotic acid
المردود 45.3%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةthe mixture was refluxed
  2. 2
    درجة الحرارةunder heating for 20 hours
  3. 3
    تركيزThen, the reaction mixture was concentrated
  4. 4
    workup.ADDITIONwater was added to the residue
  5. 5
    غسيلThe aqueous layer was washed with ether
  6. 6
    استخلاصextracted with ether
  7. 7
    تجفيفThe organic layer was dried over anhydrous magnesium sulfate
  8. 8
    تركيزconcentrated under reduced pressure

الإجراء التجريبي

To a solution of 1-tert-butoxycarbonyl-4-ethylisonipecotic acid ethyl ester (570 mg) in ethanol (10 ml) was added a 1M lithium hydroxide solution (8 ml), and the mixture was refluxed under heating for 20 hours. Then, the reaction mixture was concentrated, and water was added to the residue. The aqueous layer was washed with ether acidified with 1N hydrochloric acid, and extracted with ether. The organic layer was dried over anhydrous magnesium sulfate, and concentrated under reduced pressure to give the title compound (233 mg, yield 45%).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: USRE039088E1uspto-grants-2006_05