تفاعل #1904038

ord-b9190018bb9a41e0888f68096d43b3c7

معادلة التفاعل

N[C@@H](CC(=O)O)C(=O)O
aspartic acid
CCN(CC)CC
triethyl amine
O=C(Cl)CCC(=O)Cl
succinyl chloride
N[C@@H](CC(=O)O)C(=O)O.O=C1CCC(=O)N1
Aspartic Acid Succinimide

الكواشف

لا شيء

المذيبات

ظروف التفاعل

درجة الحرارة
0°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىfitted with a condenser and nitrogen inlet
  2. 2
    درجة الحرارةrefluxed for 6 hours
  3. 3
    ترشيحThe triethyl amine hydrochloride is filtered
  4. 4
    تركيزthe filtrate is concentrated
  5. 5
    أخرىby removing the solvent under vacuum
  6. 6
    أخرىThe residue is used directly for the subsequent reaction
  7. 7
    أخرىThe residue can be purified by chromatography on silica gel

الإجراء التجريبي

This example that demonstrates how this method could be performed. 9.4 g aspartic acid, 10 ml triethyl amine and 100 ml tetrahydrofuran are transferred into a 100 ml flask fitted with a condenser and nitrogen inlet. The mixture is cooled to 0° C. and 5 g succinyl chloride is added and the mixture stirred under nitrogen atmosphere for 5 min and refluxed for 6 hours. The triethyl amine hydrochloride is filtered and the filtrate is concentrated by removing the solvent under vacuum. The residue is used directly for the subsequent reaction. The residue can be purified by chromatography on silica gel.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07597882B2uspto-grants-2009_10