تفاعل #1857550

ord-c33200089daf434cb1aba83d99804c0a

معادلة التفاعل

COC(=O)[C@@H](CCC(C)C)[C@H](C)O
(S)-methyl 2-((S)-1-hydroxyethyl)-5-methylhexanoate
CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)O)C(=O)C2
((1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid
COc1ccc(COC(=N)C(Cl)(Cl)Cl)cc1
4-methoxybenzyl 2,2,2-trichloroacetimidate
COC(=O)[C@@H](CCC(C)C)[C@H](C)OCc1ccc(OC)cc1
title compound
المردود 77.0%
COC(=O)[C@@H](CCC(C)C)[C@H](C)OCc1ccc(OC)cc1
(S)-methyl 2-((S)-1-((4-methoxybenzyl)oxy)ethyl)-5-methylhexanoate
المردود 77.0%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىThe reaction mixture was removed from the cold bath
  2. 2
    workup.ADDITIONHexane (50 mL) was added to the reaction
  3. 3
    أخرىthe precipitate was removed by filtration
  4. 4
    غسيلThe solids were washed with hexanes (2×10 mL), Celite® (2 scoopula tip-fulls)
  5. 5
    workup.ADDITIONwas added to the combined filtrate and washes
  6. 6
    أخرىthe solvent was removed under reduced pressure
  7. 7
    أخرىpurified

الإجراء التجريبي

To a solution of (S)-methyl 2-((S)-1-hydroxyethyl)-5-methylhexanoate (5.00 g, 26.6 mmol) and ((1S,4R)-7,7-dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid (camphorsulfonic acid, CSA; 0.617 g, 2.66 mmol) in DCM (53.1 mL) was added 4-methoxybenzyl 2,2,2-trichloroacetimidate (8.27 mL, 39.8 mmol) at 0° C. The reaction mixture was removed from the cold bath and stirred at room temperature for 17 h. Hexane (50 mL) was added to the reaction and the precipitate was removed by filtration. The solids were washed with hexanes (2×10 mL), Celite® (2 scoopula tip-fulls) was added to the combined filtrate and washes, and the solvent was removed under reduced pressure. The resulting adsorbed material was directly loaded onto a column and purified using flash column chromatography (80 g SiO2, 0→35% EtOAc/hexanes) to afford the title compound (6.3 g, 20.4 mmol, 77%) as a colorless oil; 1H NMR (400 MHz, CDCl3) δ 7.24-7.16 (m, 2H), 6.89-6.79 (m, 2H), 4.49 (d, J=11.2 Hz, 1H), 4.33 (d, J=11.1 Hz, 1H), 3.75 (s, 3H), 3.74-3.62 (m, 4H), 2.49 (ddd, J=10.7, 8.2, 4.0 Hz, 1H), 1.62-1.40 (m, 3H), 1.23-1.16 (m, 3H), 1.16-1.03 (m, 2H), 0.87 (d, J=3.9 Hz, 3H), 0.85 (d, J=3.9 Hz, 3H); 13C NMR (101 MHz, CDCl3) δ 175.03, 159.10, 130.63, 129.14, 113.62, 76.16, 70.71, 55.11, 52.64, 51.25, 36.58, 27.97, 26.00, 22.69, 22.17, 17.08; ESIMS m/z 331 ([M+Na]+).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US09247741B2uspto-grants-2016_02