تفاعل #1838

ord-a19347c988eb4c1c9861adc66fd17858

معادلة التفاعل

O=[N+]([O-])O
nitric acid
O=S(=O)(O)O
sulfuric acid
O=C(O)c1cccc(OC(F)(F)F)c1
3-trifluoromethoxybenzoic acid
O=C(O)c1cc(OC(F)(F)F)ccc1[N+](=O)[O-]
2-Nitro-5-trifluoromethoxybenzoic acid

الكواشف

لا شيء

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةwhile cooling
  2. 2
    درجة الحرارةThe reaction mixture was heated at 50°-55° C. for 1 hour
  3. 3
    درجة الحرارةafter cooling
  4. 4
    workup.ADDITIONwas poured onto ice
  5. 5
    ترشيحthe residue was filtered off with suction
  6. 6
    أخرىto give
  7. 7
    أخرىafter drying
  8. 8
    أخرى8.8 g of product, melting point 90°-93° C. (sintering at 85° C.)

الإجراء التجريبي

29.7 ml of nitric acid were added dropwise to 76.5 ml of concentrated sulfuric acid, while cooling and stirring, and 9.0 g (43.7 mmol) of 3-trifluoromethoxybenzoic acid were then added. The reaction mixture was heated at 50°-55° C. for 1 hour and, after cooling, was poured onto ice, and the residue was filtered off with suction to give, after drying, 8.8 g of product, melting point 90°-93° C. (sintering at 85° C.).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05726305uspto-grants-1998_03