تفاعل #1796

ord-69fd522121284a219b8d7faaa6a44613

معادلة التفاعل

COc1c(C(=O)O)cc(F)c(O)c1C
methyl 5-fluoro-2-methoxy-4-hydroxybenzoic acid
c1ccc(P(c2ccccc2)c2ccccc2)cc1
triphenylphosphine
C[C@H](O)c1ccncc1
(S)-(-)-1-(4-pyridyl)-ethanol
COC(=O)c1cc(F)c(O[C@@H](C)c2ccncc2)cc1OC
methyl 5-fluoro-2-methoxy-4-[1-(S)-(4-pyridyl)ethoxy]benzoate

المذيبات

ظروف التفاعل

درجة الحرارة
0°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.ADDITIONTo this was added, dropwise over a period of 1 h
  2. 2
    درجة الحرارةto warm to ambient temperature overnight
  3. 3
    ترشيحThe reaction was filtered
  4. 4
    أخرىthe solvent was removed under reduced pressure
  5. 5
    أخرىThe residue was chromatographed on a silica gel column
  6. 6
    أخرىthe solvent removed under reduced pressure
  7. 7
    أخرىto afford
  8. 8
    أخرىThe residue was rechromatographed on a preparative HPLC
  9. 9
    أخرىthe solvent removed under reduced pressure

الإجراء التجريبي

A stirred solution of methyl 5-fluoro-2-methoxy-4-hydroxybenzoic acid (250 mg, 1.25 mmol, see Scheme II) in THF (15 mL) was treated with triphenylphosphine (494 mg, 1.88 mmol) and cooled to 0° C. under Argon. To this was added, dropwise over a period of 1 h, a solution of (S)-(-)-1-(4-pyridyl)-ethanol (232 mg, 1.88 mmol) and N,N'-diethylazodicarboxylate (300 μL, 1.88 mmol) in THF (5 mL). The reaction was allowed to warm to ambient temperature overnight with stirring. The reaction was filtered and the solvent was removed under reduced pressure. The residue was chromatographed on a silica gel column packed in 1:1 CH2Cl2 :EtOAc and elated with same. The appropriate fractions were combined and the solvent removed under reduced pressure to afford an impure mixture of 5-fluoro-2-methoxy-4-[1-(S)-(4-pyridyl)ethoxylbenzoate. The residue was rechromatographed on a preparative HPLC using a gradient of 95:5 to 5:95 water:acetonitrile (0.1% TFA added). The appropriate fractions were combined and the solvent removed under reduced pressure to afford the methyl 5-fluoro-2-methoxy-4-[1-(S)-(4-pyridyl)ethoxy]benzoate.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05726172uspto-grants-1998_03