تفاعل #1781

ord-aaa0ddfbf41e452299afe064a36ec3cd

معادلة التفاعل

CCc1ncccc1C(=O)[O-].[Li+]
2-ethyl nicotinic acid lithium salt
[Al+3].[H-].[H-].[H-].[H-].[Li+]
lithium aluminum hydride
CCc1ncccc1CO
2-ethyl-3 -hydroxymethylpyridine

الكواشف

لا شيء

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةthen cooled to 0° C.
  2. 2
    أخرىquenched with EtOAc (949 μL)
  3. 3
    ترشيحThe solution was filtered
  4. 4
    أخرىthe solvent removed under reduced pressure
  5. 5
    workup.ADDITIONToluene was added
  6. 6
    أخرىthe solvent was removed under reduced pressure

الإجراء التجريبي

The 2-ethyl nicotinic acid lithium salt (5 g, 3.18 mmol) in distilled THF (400 mL) under nitrogen was cooled to 0° C. and lithium aluminum hydride (1M in THF) (25 mL) was added dropwise. The reaction was stirred for 3 hours at room temperature then cooled to 0° C. and quenched with EtOAc (949 μL), then H2O (949 μL), then 15% NaOH (949 μL), followed by H2O (2.8 mL). The solution was filtered and the solvent removed under reduced pressure. Toluene was added and the solvent was removed under reduced pressure to give the desired 2-ethyl-3 -hydroxymethylpyridine.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05726172uspto-grants-1998_03