تفاعل #1772019

ord-32269697fb4c4d0d9f379a8391df3316

معادلة التفاعل

O=C(OCc1ccccc1)[C@@H](O)c1ccccc1
(S)-benzyl 2-hydroxy-2-phenylacetate
CCN(CC)CC
triethylamine
Cc1ccc(S(=O)(=O)Cl)cc1
p-toluenesulfonyl chloride
Cc1ccc(S(=O)(=O)OC(C(=O)OCc2ccccc2)c2ccccc2)cc1
benzyl 2-phenyl-2-(tosyloxy)acetate

المذيبات

ظروف التفاعل

درجة الحرارة
0°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةwhile maintaining the temperature between −5° C. and 0° C
  2. 2
    workup.WAITstored in a freezer (−25° C.) for 14 hours
  3. 3
    أخرىthaw to ambient temperature
  4. 4
    غسيلwashed with water (200 mL), 1N HCl (100 mL) and brine (100 mL)
  5. 5
    تجفيفdried (MgSO4)
  6. 6
    ترشيحfiltered
  7. 7
    تركيزconcentrated in vacuo

الإجراء التجريبي

A CH2Cl2 (200 mL) solution of p-toluenesulfonyl chloride (8.65 g, 45.4 mmol) was added dropwise to a cooled (−5° C.) CH2Cl2 (200 mL) solution of (S)-benzyl 2-hydroxy-2-phenylacetate (10.0 g, 41.3 mmol), triethylamine (5.75 mL, 41.3 mmol) and 4-dimethylaminopyridine (0.504 g, 4.13 mmol), while maintaining the temperature between −5° C. and 0° C. The reaction was stirred at 0° C. for 9 hours, and then stored in a freezer (−25° C.) for 14 hours. It was allowed to thaw to ambient temperature and washed with water (200 mL), 1N HCl (100 mL) and brine (100 mL), dried (MgSO4), filtered, and concentrated in vacuo to provide benzyl 2-phenyl-2-(tosyloxy)acetate as a viscous oil which solidified upon standing (16.5 g). The chiral integrity of the product was not checked and that product was used for the next step without further purification. 1H NMR (DMSO-d6, δ=2.5, 500 MHz) δ 7.78 (d, J=8.6, 2H), 7.43-7.29 (m, 10H), 7.20 (m, 2H), 6.12 (s, 1H), 5.16 (d, J=12.5, 1H), 5.10 (d, J=12.5, 1H), 2.39 (s, 3H). RT=3.00 (Cond. III); >90% homogeneity index; LC/MS: Anal. Calcd. for [M+H]+ C22H20NaO5S: 419.09. found 419.04.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08147818B2uspto-grants-2012_04