تفاعل #1759709

ord-6918e57684bb48ceb815600083c203d8

معادلة التفاعل

O=C(Cl)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1
5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4,5-dihydro-pyrazole-3-carboxylic acid chloride
NN1CCCCC1
N-aminopiperidine
CCN(CC)CC
triethylamine
O=C(NN1CCCCC1)C1=NN(c2ccc(Cl)cc2Cl)C(c2ccc(Cl)cc2)C1
N-piperidinyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4,5-dihydropyrazole-3-carboxamide
المردود 57.0%

ظروف التفاعل

درجة الحرارة
0°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىThe resulting reaction mixture
  2. 2
    غسيلAfterwards the reaction mixture was washed with water
  3. 3
    تجفيفagain with water, dried over sodium sulfate
  4. 4
    ترشيحfiltered
  5. 5
    أخرىevaporated to dryness in a rotavapor
  6. 6
    أخرىThe resulting crude solid was crystallized from ethanol
  7. 7
    أخرىThe crystallized solid was removed via filtration
  8. 8
    تركيزthe mother liquors were concentrated
  9. 9
    أخرىto yield a second fraction of crystallized product

الإجراء التجريبي

Under nitrogen atmosphere N-aminopiperidine (0.6 mL, 5.6 mmoles) and triethylamine (4 mL) were dissolved in methylene chloride (25 mL). The resulting mixture was ice-cooled down to 0° C. and a solution of 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4,5-dihydro-pyrazole-3-carboxylic acid chloride obtained in step (c) in methylene chloride (15 mL) was added dropwise. The resulting reaction mixture was stirred at room temperature (approximately 25° C.) overnight. Afterwards the reaction mixture was washed with water, followed by a saturated aqueous solution of sodium bicarbonate, then again with water, dried over sodium sulfate, filtered and evaporated to dryness in a rotavapor. The resulting crude solid was crystallized from ethanol. The crystallized solid was removed via filtration and the mother liquors were concentrated to yield a second fraction of crystallized product. The two fractions were combined to give a total amount of 1.7 g (57% of theoretical yield) of N-piperidinyl-5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-4,5-dihydropyrazole-3-carboxamide having a melting point of 183-186° C.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07998996B2uspto-grants-2011_08