تفاعل #1738

ord-0833dde5dcd44e279ff441b2ca2671fd

معادلة التفاعل

O=C=O
carbon dioxide
Cl
hydrochloric acid
[Li][CH2]CCC
n-butyl-lithium
[Cl-].[NH4+]
ammonium chloride
CC(C)(C)[Si](C)(C)Oc1ccc(Br)cc1C12CC3CC(CC(C3)C1)C2
(2-adamantan-1-yl-4-bromo-phenoxy)-tert-butyl-dimethylsilane
CC(C)(C)[Si](C)(C)Oc1ccc(C(=O)O)cc1C12CC3CC(CC(C3)C1)C2
3-adamantan-1-yl-4-(tert-butyl-dimethyl-silanyloxy)-benzoic acid

المذيبات

ظروف التفاعل

درجة الحرارة
-78°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    workup.ADDITIONSubsequently, the reaction mixture was firstly poured into ice-cold
  2. 2
    استخلاصextracted with ethyl acetate
  3. 3
    غسيلAfter washing once with water
  4. 4
    تجفيفdrying over sodium sulfate
  5. 5
    أخرىevaporation there
  6. 6
    أخرىwas obtained a white, crystalline mass which
  7. 7
    أخرىwas recrystallized from ethyl acetate

الإجراء التجريبي

9.3 g of (2-adamantan-1-yl-4-bromo-phenoxy)-tert-butyl-dimethylsilane were dissolved in 120 ml of absolute tetrahydrofuran and treated dropwise at -78° C. with 15.5 ml of a 1.6 molar solution of n-butyl-lithium in hexane. After stirring at -78° C. for 1.5 hours, a vigorous stream of carbon dioxide was introduced for one hour. Subsequently, the reaction mixture was firstly poured into ice-cold, saturated, aqueous ammonium chloride solution, acidified cautiously to pH 3 with cold 2N hydrochloric acid and extracted with ethyl acetate. After washing once with water, drying over sodium sulfate and evaporation there was obtained a white, crystalline mass which was recrystallized from ethyl acetate and gave 7 g of 3-adamantan-1-yl-4-(tert-butyl-dimethyl-silanyloxy)-benzoic acid, m.p. 250°-252° C.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05726191uspto-grants-1998_03