تفاعل #1702099

ord-f01d81f40cd04c93817e07b38ba35577

معادلة التفاعل

CCOP(C)(=O)CCN(C(=O)C1CCC(C)CC1)c1cc(C#CC(C)(C)C)sc1C(=O)O
5-(3,3-Dimethyl-but-1-ynyl)-3-[[2-(ethoxy-methyl-phosphinoyl)-ethyl]-(4-methyl-cyclohexanecarbonyl)-amino]-thiophene-2-carboxylic acid
C[Si](C)(C)I
TMSI
Cc1cccc(C)n1
2,6-lutidine
CC1CCC(C(=O)N(CCP(C)(=O)O)c2cc(C#CC(C)(C)C)sc2C(=O)O)CC1
5-(3,3-Dimethyl-but-1-ynyl)-3-[[2-(hydroxy-methyl-phosphinoyl)-ethyl]-(4-methyl-cyclohexanecarbonyl)-amino]-thiophene-2-carboxylic acid
المردود 36.3%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةThis solution was cooled in an ice bath
  2. 2
    أخرىsome precipitate was formed
  3. 3
    أخرىresulting in a clear solution
  4. 4
    أخرىThe ice bath was removed
  5. 5
    workup.ADDITIONAdditional TMSI (50 μL) and 2,6-lutidine (50 μL) were added
  6. 6
    workup.WAITAfter 45 minutes the reaction was determined by LC/MS
  7. 7
    درجة الحرارةThe reaction was cooled in an ice bath
  8. 8
    workup.ADDITIONadditional 2,6-lutidine (100 μL) was added
  9. 9
    درجة الحرارةThe reaction was warmed to room temperature
  10. 10
    تركيزconcentrated under vacuum

الإجراء التجريبي

5-(3,3-Dimethyl-but-1-ynyl)-3-[[2-(ethoxy-methyl-phosphinoyl)-ethyl]-(4-methyl-cyclohexanecarbonyl)-amino]-thiophene-2-carboxylic acid (108 mg, 0.225 mmol) was dissolved in acetonitrile (3 mL). This solution was cooled in an ice bath and TMSI (160 μL, 1.12 mmol) was added dropwise. The reaction turned yellow and some precipitate was formed. After approximately 1 minute 2,6-lutidine (156 μL, 1.35 mmol) was added, resulting in a clear solution. The ice bath was removed and the reaction was stirred at room temperature for 2 hours. Additional TMSI (50 μL) and 2,6-lutidine (50 μL) were added. After 45 minutes the reaction was determined by LC/MS to be complete. The reaction was cooled in an ice bath and additional 2,6-lutidine (100 μL) was added, followed by MeOH (2 mL). The reaction was warmed to room temperature and concentrated under vacuum. 5-(3,3-Dimethyl-but-1-ynyl)-3-[[2-(hydroxy-methyl-phosphinoyl)-ethyl]-(4-methyl-cyclohexanecarbonyl)-amino]-thiophene-2-carboxylic acid (37 mg, 36%) was isolated from the residue by reverse phase HPLC. MS (m/z): 453.93 [M+H]+; 31P NMR (161.9 MHz, CD3OD): d 49.909.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08765722B2uspto-grants-2014_07