تفاعل #1563886

ord-9e24c8bde91e490daaf6cf1293d46943

معادلة التفاعل

COc1ccc([C@@H]2Sc3ccccc3N(CCN(C)C)C(=O)[C@@H]2OC(C)=O)cc1.Cl
Diltiazem HCL
C=C(C)C(=O)OC.CCOC(=O)CC(O)(CC(=O)OCC)C(=O)OCC.COc1ccc([C@@H]2Sc3ccccc3N(CCN(C)C)C(=O)[C@@H]2OC(C)=O)cc1
Diltiazem Eudragit Triethly Citrate
CCOC(=O)CC(O)(CC(=O)OCC)C(=O)OCC
Triethyl Citrate
COc1ccc([C@@H]2Sc3ccccc3N(CCN(C)C)C(=O)[C@@H]2OC(C)=O)cc1
Diltiazem

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةthrough multiple heating zones to the extrusion nozzle
  2. 2
    أخرىmay then be passed through the heated extruder at a temperature range of about 75° C. to about 150° C.
  3. 3
    أخرىis fed through a further extruder inlet
  4. 4
    workup.ADDITIONmixed, whereupon it

الإجراء التجريبي

An appropriate amount of Diltiazem HCL, Eudragit® RS PO, and Triethyl Citrate is fed into an extruder hopper. The extruder to be used may have a double screw solids conveying mechanism that extends from the hopper through multiple heating zones to the extrusion nozzle, through the nozzle inlet. The solid mixture may then be passed through the heated extruder at a temperature range of about 75° C. to about 150° C., as determined by the temperature setting of the extruder heating zones so that melting of the Eudragit® RS PO occurred. Prior to exiting the die and while the Diltiazem/Eudragit/Triethly Citrate extrudate remains in the molten state, molten gelatine is fed through a further extruder inlet fed and mixed, whereupon it exits the vibrating nozzle.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US09402788B2uspto-grants-2016_08