تفاعل #155348

ord-db463c7788804fef93219af78f994f67

معادلة التفاعل

Cl
hydrochloric acid
CCCOc1ccc(F)c2c(=O)c(-c3ccc(OCCOC4CCCCO4)cc3)cn(CC(=O)OCC)c12
ethyl (5-fluoro-4-oxo-8-propoxy-3-{4-[2-(tetrahydropyran-2-yloxy)ethoxy]phenyl}-4H-quinolin-1-yl)acetate
CCCOc1ccc(F)c2c(=O)c(-c3ccc(OCCO)cc3)cn(CC(=O)OCC)c12
ethyl{5-fluoro-3-[4-(2-hydroxyethoxy)phenyl]-4-oxo-8-propoxy-4H-quinolin-1-yl}acetate
المردود 89.0%

المذيبات

ظروف التفاعل

درجة الحرارة
50°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةThe resulting mixture was cooled to room temperature
  2. 2
    تركيزconcentrated under reduced pressure
  3. 3
    workup.ADDITIONEthyl acetate and water were added to the residue
  4. 4
    أخرىfollowed by separation
  5. 5
    غسيلThe thus-obtained organic layer was washed with an aqueous saturated sodium chloride solution
  6. 6
    تركيزconcentrated under reduced pressure
  7. 7
    أخرىThe residue was purified
  8. 8
    تركيزThe purified product was concentrated under reduced pressure

الإجراء التجريبي

2N hydrochloric acid (6.3 ml) was added to an ethanol solution (20 ml) of ethyl (5-fluoro-4-oxo-8-propoxy-3-{4-[2-(tetrahydropyran-2-yloxy)ethoxy]phenyl}-4H-quinolin-1-yl)acetate (840 mg, 1.59 mmol) and stirred at 50° C. for 2 hours. The resulting mixture was cooled to room temperature and then concentrated under reduced pressure. Ethyl acetate and water were added to the residue, followed by separation. The thus-obtained organic layer was washed with an aqueous saturated sodium chloride solution, and then concentrated under reduced pressure. The residue was purified using silica gel column chromatography (dichloromethane:methanol=30:1→15:1). The purified product was concentrated under reduced pressure, giving a pale yellow oily substance of ethyl{5-fluoro-3-[4-(2-hydroxyethoxy)phenyl]-4-oxo-8-propoxy-4H-quinolin-1-yl}acetate (627 mg, yield: 89%).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: USRE045108E1uspto-grants-2014_09